The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8-Oxo-2-(pyridin-2-ylmethoxy)-7-pyridin-2-ylmethyl-5-(3,4,5-trimethoxy-phenyl)-7,8-dihydro-[1,7]naphthyridine-6-carboxylic acid methyl ester 2M HCl ID: ALA539778
PubChem CID: 44314928
Max Phase: Preclinical
Molecular Formula: C31H29ClN4O7
Molecular Weight: 568.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1c(-c2cc(OC)c(OC)c(OC)c2)c2ccc(OCc3ccccn3)nc2c(=O)n1Cc1ccccn1.Cl
Standard InChI: InChI=1S/C31H28N4O7.ClH/c1-38-23-15-19(16-24(39-2)29(23)40-3)26-22-11-12-25(42-18-21-10-6-8-14-33-21)34-27(22)30(36)35(28(26)31(37)41-4)17-20-9-5-7-13-32-20;/h5-16H,17-18H2,1-4H3;1H
Standard InChI Key: NXOJOIBLNWOVME-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 46 0 0 0 0 0 0 0 0999 V2000
11.5923 -1.1201 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2919 -2.9980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9091 -1.5019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2813 -5.9982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5829 -5.2528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0151 -5.2437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0099 -3.7437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5882 -3.7528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9091 1.5019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2928 2.6973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2030 3.7575 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7933 0.7419 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9494 -0.9039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8942 1.4964 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9067 3.0027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4942 1.4919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2729 -7.4990 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9067 -3.0027 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8816 -6.0051 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3191 -5.9869 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1929 0.7441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1976 5.2575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0923 1.4919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6050 3.7481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4943 2.9919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2307 -8.0939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3553 -5.3817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9447 -3.6050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9221 -5.4073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0923 2.9919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8958 6.0028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7933 3.7419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5995 5.2481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 2 0
2 5 1 0
5 6 1 0
4 7 1 0
6 7 1 0
4 8 1 0
6 9 2 0
3 10 1 0
11 12 2 0
11 13 1 0
8 14 1 0
13 14 2 0
8 15 2 0
12 15 1 0
2 16 1 0
7 17 2 0
9 18 1 0
5 19 2 0
10 22 2 0
18 23 1 0
16 24 1 0
20 24 2 0
17 25 1 0
18 25 2 0
21 26 1 0
11 27 1 0
10 28 1 0
12 29 1 0
13 30 1 0
23 31 1 0
26 31 1 0
20 32 1 0
21 33 2 0
24 34 1 0
26 35 2 0
27 36 1 0
30 37 1 0
28 38 1 0
29 39 1 0
33 40 1 0
32 41 2 0
35 42 1 0
40 42 2 0
34 43 2 0
41 43 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 568.59Molecular Weight (Monoisotopic): 568.1958AlogP: 4.29#Rotatable Bonds: 10Polar Surface Area: 123.89Molecular Species: NEUTRALHBA: 11HBD: ┄#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 4.28CX LogP: 3.30CX LogD: 3.30Aromatic Rings: 5Heavy Atoms: 42QED Weighted: 0.23Np Likeness Score: -0.79
References 1. Ukita T, Nakamura Y, Kubo A, Yamamoto Y, Moritani Y, Saruta K, Higashijima T, Kotera J, Fujishige K, Takagi M, Kikkawa K, Omori K.. (2003) 1,7- and 2,7-naphthyridine derivatives as potent and highly specific PDE5 inhibitors., 13 (14): [PMID:12824030 ] [10.1016/s0960-894x(03)00440-2 ]