The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8-(4-Naphthalen-2-yl-benzenesulfonylamino)-7-pyridin-3-yl-octanoic acid hydrochloride ID: ALA541097
PubChem CID: 44357794
Max Phase: Preclinical
Molecular Formula: C29H31ClN2O4S
Molecular Weight: 502.64
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cl.O=C(O)CCCCCC(CNS(=O)(=O)c1ccc(-c2ccc3ccccc3c2)cc1)c1cccnc1
Standard InChI: InChI=1S/C29H30N2O4S.ClH/c32-29(33)11-3-1-2-9-27(26-10-6-18-30-20-26)21-31-36(34,35)28-16-14-23(15-17-28)25-13-12-22-7-4-5-8-24(22)19-25;/h4-8,10,12-20,27,31H,1-3,9,11,21H2,(H,32,33);1H
Standard InChI Key: XJOFFWYWHXPMFJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 39 0 0 0 0 0 0 0 0999 V2000
5.0929 4.5320 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-7.7912 3.7794 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-7.7822 5.2802 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.4965 3.0203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8267 4.3858 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-8.8343 3.1860 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9086 1.5029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2681 7.4771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9605 8.3237 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-9.0769 6.0392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2238 8.0684 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.1925 3.7616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5065 1.5203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2125 0.7617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8985 3.0029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3625 8.2991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0678 7.5401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2778 6.2772 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-11.6686 7.5615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5620 8.2376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9463 9.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3484 9.7991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7618 8.2796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8680 7.4981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4679 7.5191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1619 8.2586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6403 10.5614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
2 4 1 0
2 6 2 0
2 7 2 0
5 8 1 0
5 9 1 0
8 11 2 0
3 13 1 0
5 14 2 0
10 15 2 0
4 16 2 0
4 17 1 0
9 18 1 0
17 18 2 0
9 19 2 0
16 19 1 0
11 20 1 0
14 21 1 0
20 21 2 0
13 23 1 0
22 23 1 0
10 24 1 0
12 25 1 0
22 25 2 0
10 26 1 0
12 27 2 0
11 28 1 0
22 29 1 0
20 30 1 0
23 31 1 0
26 32 1 0
31 33 1 0
32 34 1 0
33 34 1 0
27 35 1 0
29 35 2 0
28 36 2 0
30 37 2 0
36 37 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 502.64Molecular Weight (Monoisotopic): 502.1926AlogP: 6.00#Rotatable Bonds: 12Polar Surface Area: 96.36Molecular Species: ACIDHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.00CX Basic pKa: 4.96CX LogP: 4.63CX LogD: 2.48Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.23Np Likeness Score: -0.47
References 1. Main AJ, Goldstein R, Cohen DS, Furness P, Lee W.. (1992) Thromboxane receptor antagonism combined with thromboxane synthase inhibition. 2. Synthesis and biological activity of 8-(benzenesulfonamido)-7-(3-pyridinyl)octaonic acid and related compounds., 35 (23): [PMID:1447736 ] [10.1021/jm00101a013 ]