4-isopropenyl-12-methyl-7-methyloxycarbonyl-17-oxo-(2S,4S,12R,14R)-11,16,18,19-tetraoxapentacyclo[12.2.2.16,9.01,15.010,12]nonadeca-6,8-dien-2-yl acetate (Lopholide)

ID: ALA54145

PubChem CID: 44296331

Max Phase: Preclinical

Molecular Formula: C23H26O9

Molecular Weight: 446.45

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C(C)[C@@H]1Cc2oc(cc2C(=O)OC)[C@@H]2O[C@@]2(C)C[C@H]2OC(=O)[C@@]3(O[C@H]23)[C@@H](OC(C)=O)C1

Standard InChI:  InChI=1S/C23H26O9/c1-10(2)12-6-14-13(20(25)27-5)8-15(29-14)18-22(4,31-18)9-16-19-23(32-19,21(26)30-16)17(7-12)28-11(3)24/h8,12,16-19H,1,6-7,9H2,2-5H3/t12-,16-,17+,18+,19-,22+,23-/m1/s1

Standard InChI Key:  QFVLPFJFNHETFU-PODBDYCPSA-N

Molfile:  

     RDKit          2D

 35 39  0  0  1  0  0  0  0  0999 V2000
    6.1375   -7.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6625   -6.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9875   -6.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2250   -6.7792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6167   -5.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3750   -6.4667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9500   -4.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9375   -7.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1750   -5.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1375   -5.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3875   -4.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1750   -7.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6625   -5.9167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6667   -7.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3625   -7.9042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6292   -7.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2875   -4.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9792   -6.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7042   -5.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6667   -6.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6667   -7.9292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5875   -6.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2625   -8.2667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8250   -8.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8875   -4.5667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4000   -8.6667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8875   -5.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5125   -6.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0417   -3.9667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9000   -6.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3917   -8.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4417   -3.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4531   -8.0087    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3685   -6.4886    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.1186   -7.8691    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3 16  1  0
  1  4  1  1
  5  3  1  0
  3  6  1  0
  7 10  2  0
  8  1  1  0
  9  5  1  0
 10 19  1  0
 11  7  1  0
 12  2  1  0
 13 10  1  0
 14  1  1  0
 15  8  1  0
 16 12  1  0
 17  7  1  0
 18 20  1  0
 19 18  1  0
 20 14  1  0
 14 21  1  6
 18 22  1  1
 23  8  2  0
 24 21  1  0
 25 17  2  0
 26 24  2  0
 27 22  2  0
  3 28  1  1
 29 17  1  0
 30 22  1  0
 31 24  1  0
 32 29  1  0
  2  4  1  0
 12 15  1  0
  5  6  1  0
  9 13  1  0
  9 11  2  0
 12 33  1  1
  5 34  1  6
  2 35  1  6
M  END

Associated Targets(non-human)

CHRNA1 Acetylcholine receptor (120 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 446.45Molecular Weight (Monoisotopic): 446.1577AlogP: 2.42#Rotatable Bonds: 3
Polar Surface Area: 117.10Molecular Species: NEUTRALHBA: 9HBD:
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 2.02CX LogD: 2.02
Aromatic Rings: 1Heavy Atoms: 32QED Weighted: 0.30Np Likeness Score: 2.98

References

1. Abramson SN, Trischman JA, Tapiolas DM, Harold EE, Fenical W, Taylor P..  (1991)  Structure/activity and molecular modeling studies of the lophotoxin family of irreversible nicotinic receptor antagonists.,  34  (6): [PMID:1676426] [10.1021/jm00110a007]

Source