4alpha-Phorbol 13-decanoate

ID: ALA541720

PubChem CID: 42637025

Max Phase: Preclinical

Molecular Formula: C30H46O7

Molecular Weight: 518.69

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Synonyms: 4Alpha-Phorbol 13-Decanoate | 4alpha-Phorbol 13-decanoate|CHEMBL541720|BDBM50277486

Canonical SMILES:  CCCCCCCCCC(=O)O[C@@]12[C@H](O)[C@@H](C)[C@@]3(O)[C@@H](C=C(CO)C[C@@]4(O)C(=O)C(C)=C[C@@H]34)[C@@H]1C2(C)C

Standard InChI:  InChI=1S/C30H46O7/c1-6-7-8-9-10-11-12-13-23(32)37-30-24(27(30,4)5)21-15-20(17-31)16-28(35)22(14-18(2)25(28)33)29(21,36)19(3)26(30)34/h14-15,19,21-22,24,26,31,34-36H,6-13,16-17H2,1-5H3/t19-,21+,22-,24-,26-,28+,29-,30-/m1/s1

Standard InChI Key:  YJFFPVQHOKPCRV-JQRZRIHSSA-N

Molfile:  

     RDKit          2D

 40 43  0  0  0  0  0  0  0  0999 V2000
    2.8120  -15.2580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4240  -15.7961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2476  -15.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9752  -14.0301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6887  -14.4435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6896  -12.7972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9726  -13.2078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9605  -15.1119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2097  -14.3216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5351  -13.8403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1312  -14.3333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1319  -15.1191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2856  -13.5696    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3707  -14.9019    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5463  -16.6272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3617  -16.7530    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5417  -15.8208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9208  -14.7333    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9180  -14.0852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3472  -15.7908    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6917  -11.9722    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2582  -12.7952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4031  -13.2107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3964  -14.0306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1098  -13.6264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9792  -14.6125    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8083  -12.4917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6333  -12.4831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0384  -11.7644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0532  -13.1933    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6917  -14.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9333  -13.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8633  -11.7559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2684  -11.0372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0934  -11.0286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4984  -10.3099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3234  -10.3014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7285   -9.5827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5534   -9.5741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9585   -8.8554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  8  9  1  0
 11 19  1  0
  1  3  2  0
 12 20  2  0
  2  3  1  0
  6 21  1  1
  4  5  1  0
  7 22  1  6
 24 23  1  0
 25 24  1  0
 23 25  1  0
  5  1  1  0
  9  4  1  0
  9 10  1  0
 10 11  2  0
 24 26  1  6
 11 12  1  0
 23 27  1  6
 12  8  1  0
 27 28  1  0
  8  2  1  0
 28 29  1  0
  4 13  1  6
 28 30  2  0
 25 31  1  0
  5 14  1  1
 25 32  1  0
  4  7  1  0
 29 33  1  0
  3 15  1  0
 33 34  1  0
  5 24  1  0
 34 35  1  0
 15 16  1  0
 35 36  1  0
 23  6  1  0
 36 37  1  0
  8 17  1  6
 37 38  1  0
  6  7  1  0
 38 39  1  0
  9 18  1  6
 39 40  1  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(Human)

HEK293 (82097 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Trpv4 Transient receptor potential cation channel subfamily V member 4 (46 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 518.69Molecular Weight (Monoisotopic): 518.3244AlogP: 3.62#Rotatable Bonds: 10
Polar Surface Area: 124.29Molecular Species: NEUTRALHBA: 7HBD: 4
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.54CX Basic pKa: CX LogP: 3.47CX LogD: 3.47
Aromatic Rings: Heavy Atoms: 37QED Weighted: 0.20Np Likeness Score: 2.62

References

1. Klausen TK, Pagani A, Minassi A, Ech-Chahad A, Prenen J, Owsianik G, Hoffmann EK, Pedersen SF, Appendino G, Nilius B..  (2009)  Modulation of the transient receptor potential vanilloid channel TRPV4 by 4alpha-phorbol esters: a structure-activity study.,  52  (9): [PMID:19361196] [10.1021/jm9001007]

Source