The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-Methoxysuccinyl-L-phenylalanyl-L-alanyl[(2,4,6-Trimethylbenzoyl)oxy)methyl ketone ID: ALA54855
PubChem CID: 44297797
Max Phase: Preclinical
Molecular Formula: C28H34N2O7
Molecular Weight: 510.59
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)CCC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C)C(=O)COC(=O)c1c(C)cc(C)cc1C
Standard InChI: InChI=1S/C28H34N2O7/c1-17-13-18(2)26(19(3)14-17)28(35)37-16-23(31)20(4)29-27(34)22(15-21-9-7-6-8-10-21)30-24(32)11-12-25(33)36-5/h6-10,13-14,20,22H,11-12,15-16H2,1-5H3,(H,29,34)(H,30,32)/t20-,22+/m1/s1
Standard InChI Key: XRLVOPPAVKATBE-IRLDBZIGSA-N
Molfile:
RDKit 2D
37 38 0 0 1 0 0 0 0 0999 V2000
3.8917 -3.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7792 -12.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0750 -12.7708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4750 -12.7625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8875 -5.2542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7792 -10.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5917 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2917 -3.7458 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1833 -7.5083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2833 -5.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1875 -6.0083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4792 -9.7625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4708 -14.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0667 -14.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3292 -8.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9333 -3.1583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4833 -8.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5958 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8208 -9.9167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7667 -15.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1458 -8.1083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3208 -5.8542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3667 -7.6375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0208 -5.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0250 -7.4958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2958 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3333 -9.7417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1167 -12.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4375 -12.1583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2292 -5.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7625 -16.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2958 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3750 -10.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3000 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3000 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 6 1 0
3 2 2 0
4 2 1 0
5 1 1 0
6 12 1 0
7 1 1 0
7 8 1 1
9 11 1 0
10 8 1 0
11 5 1 0
12 17 1 0
13 4 2 0
14 3 1 0
15 25 1 0
16 1 2 0
17 9 1 0
18 7 1 0
19 6 2 0
20 13 1 0
21 9 2 0
22 10 2 0
23 15 2 0
24 10 1 0
25 24 1 0
26 18 1 0
27 15 1 0
28 3 1 0
29 4 1 0
11 30 1 6
31 20 1 0
32 26 2 0
33 26 1 0
34 27 1 0
35 33 2 0
36 32 1 0
37 35 1 0
37 36 2 0
20 14 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 510.59Molecular Weight (Monoisotopic): 510.2366AlogP: 2.52#Rotatable Bonds: 12Polar Surface Area: 127.87Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.08CX Basic pKa: ┄CX LogP: 3.88CX LogD: 3.88Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.42Np Likeness Score: -0.25
References 1. Wagner BM, Smith RA, Coles PJ, Copp LJ, Ernest MJ, Krantz A.. (1994) In vivo inhibition of cathepsin B by peptidyl (acyloxy)methyl ketones., 37 (12): [PMID:8021922 ] [10.1021/jm00038a012 ]