(R,S)-diethyl 2-(1-(naphthalen-2-yl)-3-oxo-4-((2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)butyl)malonate

ID: ALA551380

PubChem CID: 45269766

Max Phase: Preclinical

Molecular Formula: C27H34O10

Molecular Weight: 518.56

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)C(C(=O)OCC)C(CC(=O)C[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)c1ccc2ccccc2c1

Standard InChI:  InChI=1S/C27H34O10/c1-3-35-26(33)22(27(34)36-4-2)19(17-10-9-15-7-5-6-8-16(15)11-17)12-18(29)13-20-23(30)25(32)24(31)21(14-28)37-20/h5-11,19-25,28,30-32H,3-4,12-14H2,1-2H3/t19?,20-,21+,23-,24+,25+/m0/s1

Standard InChI Key:  OLTMNFSLVUGKED-LVXLBCKOSA-N

Molfile:  

     RDKit          2D

 37 39  0  0  0  0  0  0  0  0999 V2000
   10.2662    1.3010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9779    0.8885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6937    1.3010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4054    0.8885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9779    0.0635    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.1213    1.3010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5503    0.8885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5503    0.0635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2662   -0.3490    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8344   -0.3490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8344   -1.1740    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1186    0.0635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4069   -0.3490    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1186    0.8885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8344    1.3010    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4069    1.3010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6910    0.8885    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4044    0.0635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8354    0.8879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5502    1.2998    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8347    0.0629    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2644    0.8867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9792    1.2986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1220    2.1260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8368    2.5379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4079    2.5391    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5509    2.1248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2657    2.5367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6897   -0.3444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6883   -1.1687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1180   -0.3440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1201   -1.1669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4034   -1.5812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4048   -2.4071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1222   -2.8198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8397   -2.4005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8347   -1.5759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  6 19  1  0
  2  3  1  0
 19 20  1  0
  3  4  1  0
 19 21  2  0
  2  5  2  0
 20 22  1  0
  4  6  1  0
 22 23  1  0
  7  8  1  0
  6 24  1  0
  8  9  1  6
 24 25  1  0
  8 10  1  0
 24 26  2  0
 10 11  1  1
 25 27  1  0
 10 12  1  0
 27 28  1  0
 12 13  1  6
 18 29  2  0
 12 14  1  0
 29 30  1  0
 30 33  2  0
 14 15  1  0
 32 31  2  0
 31 18  1  0
 14 16  1  1
 16 17  1  0
 32 33  1  0
  7 15  1  0
 33 34  1  0
  7  1  1  1
 34 35  2  0
 35 36  1  0
  4 18  1  0
 36 37  2  0
 37 32  1  0
M  END

Associated Targets(non-human)

Gaa Acidic alpha-glucosidase (551 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
G6pc1 Glucose-6-phosphatase (38 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Pygl Liver glycogen phosphorylase (81 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 518.56Molecular Weight (Monoisotopic): 518.2152AlogP: 0.86#Rotatable Bonds: 11
Polar Surface Area: 159.82Molecular Species: NEUTRALHBA: 10HBD: 4
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.60CX Basic pKa: CX LogP: 0.96CX LogD: 0.96
Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.25Np Likeness Score: 0.61

References

1. Bisht SS, Fatima S, Tamrakar AK, Rahuja N, Jaiswal N, Srivastava AK, Tripathi RP..  (2009)  Synthetic studies in butenonyl C-glycosides: Preparation of polyfunctional alkanonyl glycosides and their enzyme inhibitory activity.,  19  (10): [PMID:19362832] [10.1016/j.bmcl.2009.03.136]

Source