The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-Chlorobenzyl)-1-ethyl-4-oxo-7-(trifluoromethyl)-1,4-dihydroquinoline-3-carboxamide ID: ALA551697
PubChem CID: 44190928
Max Phase: Preclinical
Molecular Formula: C20H16ClF3N2O2
Molecular Weight: 408.81
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCn1cc(C(=O)NCc2ccc(Cl)cc2)c(=O)c2ccc(C(F)(F)F)cc21
Standard InChI: InChI=1S/C20H16ClF3N2O2/c1-2-26-11-16(19(28)25-10-12-3-6-14(21)7-4-12)18(27)15-8-5-13(9-17(15)26)20(22,23)24/h3-9,11H,2,10H2,1H3,(H,25,28)
Standard InChI Key: CLCAOWVXXGBURD-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
-3.1468 1.4105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1468 0.5855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4323 0.1730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4323 1.8230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7178 1.4105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7178 0.5855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0033 0.1730 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2889 0.5855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2889 1.4105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0033 1.8230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0033 2.6480 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4256 1.8230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1401 1.4105 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4256 2.6480 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8612 0.1730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5757 -0.2395 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.4487 -0.5414 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.2737 0.8875 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.0033 -0.6520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2889 -1.0645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8545 1.8230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5690 1.4105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2835 1.8230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9980 1.4105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9980 0.5855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2835 0.1730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5690 0.5855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7124 0.1730 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3 6 2 0
12 14 2 0
1 2 2 0
2 15 1 0
5 4 2 0
15 16 1 0
4 1 1 0
15 17 1 0
5 10 1 0
15 18 1 0
6 7 1 0
7 19 1 0
7 8 1 0
19 20 1 0
8 9 2 0
13 21 1 0
9 10 1 0
21 22 1 0
5 6 1 0
22 23 2 0
10 11 2 0
23 24 1 0
24 25 2 0
9 12 1 0
25 26 1 0
2 3 1 0
26 27 2 0
27 22 1 0
12 13 1 0
25 28 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 408.81Molecular Weight (Monoisotopic): 408.0852AlogP: 4.62#Rotatable Bonds: 4Polar Surface Area: 51.10Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.88CX Basic pKa: ┄CX LogP: 4.35CX LogD: 4.35Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.68Np Likeness Score: -1.57
References 1. Niedermeier S, Singethan K, Rohrer SG, Matz M, Kossner M, Diederich S, Maisner A, Schmitz J, Hiltensperger G, Baumann K, Holzgrabe U, Schneider-Schaulies J.. (2009) A small-molecule inhibitor of Nipah virus envelope protein-mediated membrane fusion., 52 (14): [PMID:19499921 ] [10.1021/jm900411s ]