N-(4-Chlorobenzyl)-1-ethyl-4-oxo-7-(trifluoromethyl)-1,4-dihydroquinoline-3-carboxamide

ID: ALA551697

PubChem CID: 44190928

Max Phase: Preclinical

Molecular Formula: C20H16ClF3N2O2

Molecular Weight: 408.81

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCn1cc(C(=O)NCc2ccc(Cl)cc2)c(=O)c2ccc(C(F)(F)F)cc21

Standard InChI:  InChI=1S/C20H16ClF3N2O2/c1-2-26-11-16(19(28)25-10-12-3-6-14(21)7-4-12)18(27)15-8-5-13(9-17(15)26)20(22,23)24/h3-9,11H,2,10H2,1H3,(H,25,28)

Standard InChI Key:  CLCAOWVXXGBURD-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
   -3.1468    1.4105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1468    0.5855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4323    0.1730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4323    1.8230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7178    1.4105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7178    0.5855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0033    0.1730    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2889    0.5855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2889    1.4105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0033    1.8230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0033    2.6480    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4256    1.8230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1401    1.4105    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4256    2.6480    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8612    0.1730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5757   -0.2395    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4487   -0.5414    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2737    0.8875    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0033   -0.6520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2889   -1.0645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8545    1.8230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5690    1.4105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2835    1.8230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9980    1.4105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9980    0.5855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2835    0.1730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5690    0.5855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7124    0.1730    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  3  6  2  0
 12 14  2  0
  1  2  2  0
  2 15  1  0
  5  4  2  0
 15 16  1  0
  4  1  1  0
 15 17  1  0
  5 10  1  0
 15 18  1  0
  6  7  1  0
  7 19  1  0
  7  8  1  0
 19 20  1  0
  8  9  2  0
 13 21  1  0
  9 10  1  0
 21 22  1  0
  5  6  1  0
 22 23  2  0
 10 11  2  0
 23 24  1  0
 24 25  2  0
  9 12  1  0
 25 26  1  0
  2  3  1  0
 26 27  2  0
 27 22  1  0
 12 13  1  0
 25 28  1  0
M  END

Associated Targets(non-human)

G Glycoprotein G (19 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Vero (26788 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 408.81Molecular Weight (Monoisotopic): 408.0852AlogP: 4.62#Rotatable Bonds: 4
Polar Surface Area: 51.10Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.88CX Basic pKa: CX LogP: 4.35CX LogD: 4.35
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.68Np Likeness Score: -1.57

References

1. Niedermeier S, Singethan K, Rohrer SG, Matz M, Kossner M, Diederich S, Maisner A, Schmitz J, Hiltensperger G, Baumann K, Holzgrabe U, Schneider-Schaulies J..  (2009)  A small-molecule inhibitor of Nipah virus envelope protein-mediated membrane fusion.,  52  (14): [PMID:19499921] [10.1021/jm900411s]

Source