25-hydroxyhalisulfate 9

ID: ALA552301

PubChem CID: 25242870

Max Phase: Preclinical

Molecular Formula: C25H40O7S

Molecular Weight: 484.66

Molecule Type: Small molecule

Names and Identifiers

Synonyms: 25-Hydroxyhalisulfate 9 | 25-hydroxyhalisulfate 9|CHEMBL552301|[2-[2-[(1S,2S,4aR)-1,2,5,5-tetramethyl-2,3,4,4a,6,7-hexahydronaphthalen-1-yl]ethyl]-5-(2-hydroxy-5-oxo-2H-furan-3-yl)pentyl] hydrogen sulfate

Canonical SMILES:  C[C@H]1CC[C@H]2C(=CCCC2(C)C)[C@@]1(C)CCC(CCCC1=CC(=O)OC1O)COS(=O)(=O)O

Standard InChI:  InChI=1S/C25H40O7S/c1-17-10-11-20-21(9-6-13-24(20,2)3)25(17,4)14-12-18(16-31-33(28,29)30)7-5-8-19-15-22(26)32-23(19)27/h9,15,17-18,20,23,27H,5-8,10-14,16H2,1-4H3,(H,28,29,30)/t17-,18?,20-,23?,25-/m0/s1

Standard InChI Key:  UTGHYWBAVNHHJG-TYMBNJMISA-N

Molfile:  

     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
    6.4292   -7.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4292   -8.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1412   -8.9750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1412   -7.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8532   -7.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8497   -8.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5585   -8.9799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2753   -8.5727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2788   -7.7477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5655   -7.3299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8417   -9.3875    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.9954   -7.3390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5678   -6.5049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2835   -6.0945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2858   -5.2695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7208   -9.6875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3500   -9.7708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0015   -4.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5726   -4.8549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8569   -5.2654    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1436   -4.8508    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.4250   -4.4375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5566   -4.1366    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7342   -5.5671    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7148   -5.2735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4304   -4.8631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1437   -5.2776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2257   -6.0962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0322   -6.2701    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.4467   -5.5567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8964   -4.9422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2750   -6.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2675   -5.4728    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.6105   -6.6459    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  5  4  2  0
  3 17  1  0
  5 10  1  0
 15 18  1  0
  6  7  1  0
 15 19  1  0
  7  8  1  0
 19 20  1  0
  8  9  1  0
 20 21  1  0
  9 10  1  0
 21 22  1  0
  5  6  1  0
 21 23  2  0
  6 11  1  1
 21 24  2  0
 18 25  1  0
  9 12  1  1
 25 26  1  0
  1  2  1  0
 26 27  1  0
 27 28  1  0
 10 13  1  0
  1  4  1  0
 13 14  1  0
  2  3  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 27  2  0
 14 15  1  0
 10 32  1  6
  3  6  1  0
 30 33  2  0
  3 16  1  0
 28 34  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA552301

   25-Hydroxyhalisulfate 9

Molecule Features

Natural Product: Yes

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 484.66

Molecular Weight (Monoisotopic): 484.2495

AlogP: 4.97

#Rotatable Bonds: 10

Polar Surface Area: 110.13

Molecular Species: ACID

HBA: 6

HBD: 2

#RO5 Violations: ┄

HBA (Lipinski): 7

HBD (Lipinski): 2

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: -1.36

CX Basic pKa: ┄

CX LogP: 5.44

CX LogD: 2.70

Aromatic Rings: ┄

Heavy Atoms: 33

QED Weighted: 0.26

Np Likeness Score: 3.31

References

1. Yao G, Kondratyuk TP, Tan GT, Pezzuto JM, Chang LC..  (2009)  Bioactive sulfated sesterterpene alkaloids and sesterterpene sulfates from the marine sponge Fasciospongia sp.,  72  (2): [PMID:19178162] [10.1021/np8005343]

Source

Source(1):

• Scientific Literature