The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-Hydroxy-2-[(4-nitro-benzyl)-(3-(N-(4-Chloro-benzene)-sulfonyl)ureido-benzenesulfonyl)-amino]-acetamide ID: ALA55522
PubChem CID: 10698786
Max Phase: Preclinical
Molecular Formula: C22H20ClN5O9S2
Molecular Weight: 598.02
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CN(Cc1ccc([N+](=O)[O-])cc1)S(=O)(=O)c1cccc(NC(=O)NS(=O)(=O)c2ccc(Cl)cc2)c1)NO
Standard InChI: InChI=1S/C22H20ClN5O9S2/c23-16-6-10-19(11-7-16)38(34,35)26-22(30)24-17-2-1-3-20(12-17)39(36,37)27(14-21(29)25-31)13-15-4-8-18(9-5-15)28(32)33/h1-12,31H,13-14H2,(H,25,29)(H2,24,26,30)
Standard InChI Key: HGCCQMHYESJBML-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 41 0 0 0 0 0 0 0 0999 V2000
3.8667 -7.2292 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.5292 -7.2417 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.3417 -6.9292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9667 -7.0417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4292 -5.1167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5000 -7.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3792 -7.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8167 -7.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2917 -6.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0917 -7.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5542 -7.7542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1667 -6.7125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8917 -7.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9125 -5.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7417 -6.6750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3250 -7.8167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9292 -7.2167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9542 -5.4167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3417 -6.3250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4292 -4.5042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4125 -7.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4917 -8.0542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7750 -7.2292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2917 -6.3250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1875 -8.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5542 -7.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9125 -6.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3875 -5.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8667 -6.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2167 -7.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3875 -6.3250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8667 -5.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7542 -8.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1167 -7.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7875 -8.0917 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.7750 -6.0167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3792 -8.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8917 -8.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4125 -8.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 4 1 0
3 1 1 0
4 6 1 0
5 14 1 0
6 17 1 0
7 1 1 0
8 3 1 0
9 8 1 0
10 2 1 0
11 1 2 0
12 1 2 0
13 7 1 0
14 28 1 0
15 2 2 0
16 2 2 0
17 21 1 0
18 5 1 0
19 3 1 0
20 5 2 0
21 13 2 0
22 6 2 0
23 9 2 0
24 9 1 0
25 10 2 0
26 10 1 0
27 31 1 0
28 32 2 0
29 19 1 0
30 34 1 0
31 29 2 0
32 29 1 0
33 25 1 0
34 26 2 0
35 30 1 0
36 24 1 0
37 7 2 0
38 37 1 0
39 38 2 0
21 39 1 0
27 14 2 0
33 30 2 0
M CHG 2 5 1 18 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 598.02Molecular Weight (Monoisotopic): 597.0391AlogP: 2.45#Rotatable Bonds: 10Polar Surface Area: 205.12Molecular Species: ACIDHBA: 9HBD: 4#RO5 Violations: 1HBA (Lipinski): 14HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 2.60CX Basic pKa: ┄CX LogP: 2.47CX LogD: 1.50Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.15Np Likeness Score: -1.89
References 1. Scozzafava A, Supuran CT.. (2000) Protease inhibitors: synthesis of potent bacterial collagenase and matrix metalloproteinase inhibitors incorporating N-4-nitrobenzylsulfonylglycine hydroxamate moieties., 43 (9): [PMID:10794702 ] [10.1021/jm990594k ]