The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3(R)-[(4(S)-(4-azido-2-hydroxybenzoyl)amino-2(S)-pyrrolidinylcarbonyl)amino]-2-oxo-1-pyrrolidineacetamide hydrochloride ID: ALA555967
PubChem CID: 11496418
Max Phase: Preclinical
Molecular Formula: C18H23ClN8O5
Molecular Weight: 430.43
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cl.[N-]=[N+]=Nc1ccc(C(=O)N[C@@H]2CN[C@H](C(=O)N[C@@H]3CCN(CC(N)=O)C3=O)C2)c(O)c1
Standard InChI: InChI=1S/C18H22N8O5.ClH/c19-15(28)8-26-4-3-12(18(26)31)23-17(30)13-5-10(7-21-13)22-16(29)11-2-1-9(24-25-20)6-14(11)27;/h1-2,6,10,12-13,21,27H,3-5,7-8H2,(H2,19,28)(H,22,29)(H,23,30);1H/t10-,12+,13-;/m0./s1
Standard InChI Key: OLYUVFOBFOFGOX-QSXPGGQMSA-N
Molfile:
RDKit 2D
32 33 0 0 0 0 0 0 0 0999 V2000
19.8972 -0.8930 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
11.8714 -2.5845 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7973 -1.5484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0959 -0.7961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0937 0.4039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.1364 -1.3939 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1278 -1.4122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4981 -0.8020 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3413 0.6897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8741 1.0015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1458 -0.2952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8054 -3.2859 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5554 -1.9869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3382 -2.9741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5517 -0.8722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0451 -1.8272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7522 -2.7967 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6536 -0.4552 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6024 -2.6977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 1.4977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 0.7455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9374 0.1440 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -2.7000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3 4 1 0
4 5 1 0
4 6 2 0
2 7 2 0
3 8 1 0
7 8 1 0
8 9 1 0
9 10 1 0
7 11 1 0
10 11 1 0
12 13 1 0
12 14 1 0
13 15 1 0
14 16 1 0
15 16 1 0
13 17 1 1
17 18 2 0
11 19 1 6
17 19 1 0
16 20 1 1
20 21 1 0
21 22 2 0
21 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
23 28 1 0
27 28 2 0
26 29 1 0
29 30 2 0
30 31 2 0
28 32 1 0
M CHG 2 30 1 31 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 430.43Molecular Weight (Monoisotopic): 430.1713AlogP: -1.00#Rotatable Bonds: 7Polar Surface Area: 202.62Molecular Species: ZWITTERIONHBA: 7HBD: 5#RO5 Violations: ┄HBA (Lipinski): 13HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: -10.68CX Basic pKa: 8.68CX LogP: -4.96CX LogD: -2.88Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.21Np Likeness Score: -0.68
References 1. Fisher A, Mann A, Verma V, Thomas N, Mishra RK, Johnson RL.. (2006) Design and synthesis of photoaffinity-labeling ligands of the L-prolyl-L-leucylglycinamide binding site involved in the allosteric modulation of the dopamine receptor., 49 (1): [PMID:16392815 ] [10.1021/jm050644n ]