The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-Acetyl-4-hydroxy-pyrrolidine-2-carboxylic acid [1-(benzothiazole-2-carbonyl)-4-guanidino-butyl]-amide hydrochloride ID: ALA556199
PubChem CID: 45265199
Max Phase: Preclinical
Molecular Formula: C20H27ClN6O4S
Molecular Weight: 446.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)N1C[C@H](O)C[C@H]1C(=O)N[C@@H](CCCN=C(N)N)C(=O)c1nc2ccccc2s1.Cl
Standard InChI: InChI=1S/C20H26N6O4S.ClH/c1-11(27)26-10-12(28)9-15(26)18(30)24-14(6-4-8-23-20(21)22)17(29)19-25-13-5-2-3-7-16(13)31-19;/h2-3,5,7,12,14-15,28H,4,6,8-10H2,1H3,(H,24,30)(H4,21,22,23);1H/t12-,14+,15+;/m1./s1
Standard InChI Key: RJGFYDAIAYFTCT-WEMUQIOZSA-N
Molfile:
RDKit 2D
32 33 0 0 0 0 0 0 0 0999 V2000
14.5749 2.4831 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4020 3.9202 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0872 0.0382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.5560 2.6970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0553 2.6768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3216 1.3676 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9149 5.3370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8209 1.3475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4905 5.1687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4296 1.4933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8337 3.4730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6904 5.1513 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7008 -0.9931 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4417 3.7081 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8508 1.9731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7020 6.2428 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2795 3.8805 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0940 6.2167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8296 1.2788 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7370 5.5661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0509 2.6358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7802 3.9022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5502 2.6140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 4 2 0
2 5 1 0
2 6 1 0
3 7 1 0
7 8 1 1
8 9 1 0
3 10 1 0
4 11 1 0
5 12 1 0
12 9 1 6
6 14 1 0
11 14 1 0
7 15 1 0
3 16 1 0
13 17 1 0
5 18 2 0
8 19 2 0
15 20 1 0
16 20 1 0
10 21 2 0
13 22 2 0
13 23 1 0
20 24 1 6
10 25 1 0
12 26 1 0
11 27 2 0
14 28 2 0
22 29 1 0
26 30 1 0
29 30 1 0
28 31 1 0
27 32 1 0
31 32 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.53Molecular Weight (Monoisotopic): 446.1736AlogP: 0.00#Rotatable Bonds: 8Polar Surface Area: 164.00Molecular Species: BASEHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.24CX Basic pKa: 11.05CX LogP: -1.07CX LogD: -3.26Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.19Np Likeness Score: -0.30
References 1. Costanzo MJ, Yabut SC, Almond HR, Andrade-Gordon P, Corcoran TW, De Garavilla L, Kauffman JA, Abraham WM, Recacha R, Chattopadhyay D, Maryanoff BE.. (2003) Potent, small-molecule inhibitors of human mast cell tryptase. Antiasthmatic action of a dipeptide-based transition-state analogue containing a benzothiazole ketone., 46 (18): [PMID:12930148 ] [10.1021/jm030050p ]