The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
19-oxofasciospongine A ID: ALA556261
PubChem CID: 25227567
Max Phase: Preclinical
Molecular Formula: C30H45N3O6S
Molecular Weight: 575.77
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: 19-Oxofasciospongine A | 19-oxofasciospongine A|CHEMBL556261
Canonical SMILES: C[C@H]1CC[C@H]2C(=CCCC2(C)C)[C@@]1(C)CCC(CCCC1=CC(=O)N(CCc2c[nH]cn2)C1=O)COS(=O)(=O)O
Standard InChI: InChI=1S/C30H45N3O6S/c1-21-10-11-25-26(9-6-14-29(25,2)3)30(21,4)15-12-22(19-39-40(36,37)38)7-5-8-23-17-27(34)33(28(23)35)16-13-24-18-31-20-32-24/h9,17-18,20-22,25H,5-8,10-16,19H2,1-4H3,(H,31,32)(H,36,37,38)/t21-,22?,25-,30-/m0/s1
Standard InChI Key: KYSKWYJBCHWKSD-VMBXUYBNSA-N
Molfile:
RDKit 2D
41 44 0 0 0 0 0 0 0 0999 V2000
16.0375 -0.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0375 -1.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7495 -2.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7495 -0.5125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4615 -0.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4580 -1.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1668 -2.1674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8836 -1.7602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8871 -0.9352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1738 -0.5174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4500 -2.5750 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
19.6037 -0.5265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1762 0.3076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8918 0.7180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8942 1.5430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3292 -2.8750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9583 -2.9583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6098 1.9535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1809 1.9576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4652 1.5471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7519 1.9617 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.0333 2.3750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1649 2.6759 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3425 1.2454 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.3231 1.5390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0388 1.9494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7520 1.5349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8340 0.7163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6405 0.5424 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.0551 1.2558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5047 1.8703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9739 -0.2122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4871 -0.8783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8205 -1.6329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4116 -2.3446 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.9619 -2.9592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7166 -2.6258 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.6326 -1.8051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8833 -0.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8758 1.3397 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.2188 0.1666 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19 20 1 0
8 9 1 0
20 21 1 0
9 10 1 0
21 22 1 0
5 6 1 0
21 23 2 0
6 11 1 1
21 24 2 0
18 25 1 0
9 12 1 1
25 26 1 0
1 2 1 0
26 27 1 0
27 28 1 0
10 13 1 0
1 4 1 0
13 14 1 0
2 3 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 27 2 0
14 15 1 0
29 32 1 0
3 6 1 0
32 33 1 0
3 16 1 0
33 34 1 0
34 35 1 0
5 4 2 0
3 17 1 0
5 10 1 0
15 18 1 0
35 36 2 0
36 37 1 0
37 38 1 0
38 34 2 0
6 7 1 0
10 39 1 6
15 19 1 0
30 40 2 0
7 8 1 0
28 41 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 575.77Molecular Weight (Monoisotopic): 575.3029AlogP: 5.43#Rotatable Bonds: 13Polar Surface Area: 129.66Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: -1.34CX Basic pKa: 6.55CX LogP: 2.70CX LogD: 2.57Aromatic Rings: 1Heavy Atoms: 40QED Weighted: 0.18Np Likeness Score: 2.11
References 1. Yao G, Kondratyuk TP, Tan GT, Pezzuto JM, Chang LC.. (2009) Bioactive sulfated sesterterpene alkaloids and sesterterpene sulfates from the marine sponge Fasciospongia sp., 72 (2): [PMID:19178162 ] [10.1021/np8005343 ]