The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
palmatine derivative ID: ALA556601
PubChem CID: 45266455
Max Phase: Preclinical
Molecular Formula: C27H34ClNO4
Molecular Weight: 436.57
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCc1c2[n+](cc3c(OC)c(OC)ccc13)CCc1cc(OC)c(OC)cc1-2.[Cl-]
Standard InChI: InChI=1S/C27H34NO4.ClH/c1-6-7-8-9-10-20-19-11-12-23(29-2)27(32-5)22(19)17-28-14-13-18-15-24(30-3)25(31-4)16-21(18)26(20)28;/h11-12,15-17H,6-10,13-14H2,1-5H3;1H/q+1;/p-1
Standard InChI Key: JQRJCZSSOHJIKP-UHFFFAOYSA-M
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
6.5792 -3.1208 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5.7167 -4.5333 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9958 -4.9458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4292 -5.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2833 -4.5333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9917 -5.7708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7083 -6.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4292 -4.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2833 -3.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1417 -6.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5750 -4.9417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8625 -4.5333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7208 -3.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5708 -3.2958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8625 -3.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7042 -7.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1417 -7.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0000 -3.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4208 -7.4333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8542 -5.7792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2792 -6.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1500 -4.9417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1500 -3.2958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8542 -7.4250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5667 -6.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4375 -3.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4375 -4.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5667 -7.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5667 -5.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4333 -6.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1458 -5.7583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8542 -6.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7208 -5.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 2 2 0
4 8 2 0
5 3 1 0
6 3 1 0
7 4 1 0
8 2 1 0
9 5 1 0
10 4 1 0
11 5 2 0
12 11 1 0
13 2 1 0
14 9 2 0
15 14 1 0
16 7 1 0
17 10 2 0
18 13 1 0
19 16 2 0
20 10 1 0
21 6 1 0
22 12 1 0
23 15 1 0
24 17 1 0
25 20 1 0
26 23 1 0
27 22 1 0
28 24 1 0
29 21 1 0
30 31 1 0
31 32 1 0
32 29 1 0
33 30 1 0
18 9 1 0
7 6 2 0
17 19 1 0
15 12 2 0
M CHG 2 1 -1 2 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 436.57Molecular Weight (Monoisotopic): 436.2482AlogP: 5.51#Rotatable Bonds: 9Polar Surface Area: 40.80Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 1.51CX LogD: 1.51Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.33Np Likeness Score: 1.07
References 1. Iwasa K, Moriyasu M, Yamori T, Turuo T, Lee DU, Wiegrebe W.. (2001) In vitro cytotoxicity of the protoberberine-type alkaloids., 64 (7): [PMID:11473418 ] [10.1021/np000554f ] 2. Iwasa K, Moriyasu M, Nader B.. (2000) Fungicidal and herbicidal activities of berberine related alkaloids., 64 (9): [PMID:11055412 ] [10.1271/bbb.64.1998 ]