The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8'-methyl-11'-(2-(trifluoromethylthio)phenyl)-4',5',10',11'-tetrahydrospiro[cyclopentane-1,3'-dibenzo[b,e][1,4]diazepin]-1'(2'H)-one ID: ALA557707
Max Phase: Preclinical
Molecular Formula: C25H25F3N2OS
Molecular Weight: 458.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc2c(c1)NC(c1ccccc1SC(F)(F)F)C1=C(CC3(CCCC3)CC1=O)N2
Standard InChI: InChI=1S/C25H25F3N2OS/c1-15-8-9-17-18(12-15)30-23(16-6-2-3-7-21(16)32-25(26,27)28)22-19(29-17)13-24(14-20(22)31)10-4-5-11-24/h2-3,6-9,12,23,29-30H,4-5,10-11,13-14H2,1H3
Standard InChI Key: RJHHBWPHDDZAHU-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
3.9725 -1.5657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7196 -1.9155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2832 -1.3130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8843 -0.5908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0742 -0.7470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8253 -3.9312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9936 -4.7389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3783 -5.2884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5947 -5.0304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4265 -4.2227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0418 -3.6731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8735 -2.8655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9086 -1.0121 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0728 -2.6667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5438 -1.5386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5281 -2.3634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2346 -2.7894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9568 -2.3905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2659 -1.1397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7290 -1.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1010 -1.1803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6493 -0.4900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1745 -0.5360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5465 -1.2724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0947 -1.9628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3702 -1.3185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2190 -3.6143 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6429 -3.9646 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.0276 -4.5142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5877 -5.0638 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.5771 -5.1295 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.5220 -3.8989 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
7 8 1 0
3 4 1 0
8 9 2 0
4 5 1 0
15 19 1 0
16 17 1 0
17 18 1 0
18 1 1 0
1 19 1 0
9 10 1 0
5 1 1 0
20 21 2 0
10 11 2 0
21 22 1 0
11 6 1 0
22 23 2 0
1 2 1 0
23 24 1 0
11 12 1 0
24 25 2 0
25 20 1 0
24 26 1 0
21 13 1 0
17 27 2 0
13 15 1 0
10 28 1 0
6 7 2 0
20 14 1 0
28 29 1 0
16 12 1 0
29 30 1 0
14 12 1 0
29 31 1 0
15 16 2 0
29 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 458.55Molecular Weight (Monoisotopic): 458.1640AlogP: 7.36#Rotatable Bonds: 2Polar Surface Area: 41.13Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.25CX Basic pKa: 2.60CX LogP: 6.48CX LogD: 6.47Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.46Np Likeness Score: -0.75
References 1. Fu J, Shuttleworth SJ, Connors RV, Chai A, Coward P.. (2009) Discovery and optimization of a novel Neuromedin B receptor antagonist., 19 (15): [PMID:19553112 ] [10.1016/j.bmcl.2009.05.124 ]