The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-1-(beta-cellobiosyl)-4-phenylbut-3-en-2-one ID: ALA557901
PubChem CID: 45273185
Max Phase: Preclinical
Molecular Formula: C22H30O11
Molecular Weight: 470.47
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(/C=C/c1ccccc1)C[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O
Standard InChI: InChI=1S/C22H30O11/c23-9-14-17(27)18(28)20(30)22(32-14)33-21-15(10-24)31-13(16(26)19(21)29)8-12(25)7-6-11-4-2-1-3-5-11/h1-7,13-24,26-30H,8-10H2/b7-6+/t13-,14+,15+,16-,17+,18-,19+,20+,21+,22-/m0/s1
Standard InChI Key: BLAPMHQCGJOUOM-WGLPGVLQSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
1.4897 -8.9508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7752 -9.3633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7752 -10.1883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0608 -8.9508 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4897 -10.6008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4897 -11.4258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2042 -11.8383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2042 -12.6633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7752 -11.8383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7752 -12.6633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4897 -13.0758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4897 -5.6508 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2042 -5.2383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2042 -4.4133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4897 -4.0008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9187 -4.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9187 -3.1758 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6331 -4.4133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3476 -4.0008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6331 -5.2383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9187 -5.6508 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3476 -5.6508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3476 -6.4758 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4897 -6.4758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2042 -6.8883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2042 -7.7133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4897 -8.1258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7752 -7.7133 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7752 -6.8883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0608 -6.4758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6537 -6.8883 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2042 -6.0633 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.9187 -6.4758 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9187 -8.1258 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10 11 1 0
13 14 1 0
14 15 1 6
14 16 1 0
16 17 1 1
16 18 1 0
18 19 1 6
18 20 1 0
20 21 1 0
20 22 1 1
22 23 1 0
13 21 1 0
13 12 1 1
5 6 1 0
24 12 1 1
24 25 1 0
1 2 1 0
6 7 2 0
2 4 2 0
7 8 1 0
8 11 2 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 6
10 9 2 0
30 31 1 0
9 6 1 0
24 32 1 6
3 5 2 0
25 33 1 6
2 3 1 0
26 34 1 1
27 1 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 470.47Molecular Weight (Monoisotopic): 470.1788AlogP: -2.67#Rotatable Bonds: 8Polar Surface Area: 186.37Molecular Species: NEUTRALHBA: 11HBD: 7#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 7#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.11CX Basic pKa: ┄CX LogP: -1.88CX LogD: -1.88Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.20Np Likeness Score: 1.58
References 1. Bisht SS, Fatima S, Tamrakar AK, Rahuja N, Jaiswal N, Srivastava AK, Tripathi RP.. (2009) Synthetic studies in butenonyl C-glycosides: Preparation of polyfunctional alkanonyl glycosides and their enzyme inhibitory activity., 19 (10): [PMID:19362832 ] [10.1016/j.bmcl.2009.03.136 ]