The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-Ethyl-N-(4-methoxy-benzyl)-4-oxo-7-(trifluoromethyl)-1,4-dihydroquinoline-3-carboxamide ID: ALA558352
PubChem CID: 30133538
Max Phase: Preclinical
Molecular Formula: C21H19F3N2O3
Molecular Weight: 404.39
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCn1cc(C(=O)NCc2ccc(OC)cc2)c(=O)c2cc(C(F)(F)F)ccc21
Standard InChI: InChI=1S/C21H19F3N2O3/c1-3-26-12-17(20(28)25-11-13-4-7-15(29-2)8-5-13)19(27)16-10-14(21(22,23)24)6-9-18(16)26/h4-10,12H,3,11H2,1-2H3,(H,25,28)
Standard InChI Key: STBOJOLARVYICG-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
-3.5737 -1.3983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5737 -2.2233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8592 -2.6358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8592 -0.9858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1447 -1.3983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1447 -2.2233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4302 -2.6358 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7158 -2.2233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7158 -1.3983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4302 -0.9858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4302 -0.1608 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0013 -0.9858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7132 -1.3983 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0013 -0.1608 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4302 -3.4608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7158 -3.8733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4276 -0.9858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2881 -0.9858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0026 -0.5733 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.7006 -1.7003 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.8756 -0.2713 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.1421 -1.3983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8566 -0.9858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5711 -1.3983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5711 -2.2233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8566 -2.6358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1421 -2.2233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2855 -2.6358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0000 -2.2233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12 14 2 0
1 2 2 0
7 15 1 0
5 4 2 0
15 16 1 0
4 1 1 0
13 17 1 0
5 10 1 0
1 18 1 0
6 7 1 0
18 19 1 0
7 8 1 0
18 20 1 0
8 9 2 0
18 21 1 0
9 10 1 0
17 22 1 0
5 6 1 0
22 23 2 0
10 11 2 0
23 24 1 0
24 25 2 0
9 12 1 0
25 26 1 0
2 3 1 0
26 27 2 0
27 22 1 0
12 13 1 0
25 28 1 0
3 6 2 0
28 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 404.39Molecular Weight (Monoisotopic): 404.1348AlogP: 3.98#Rotatable Bonds: 5Polar Surface Area: 60.33Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 0.30CX LogP: 3.59CX LogD: 3.59Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.70Np Likeness Score: -1.45
References 1. Niedermeier S, Singethan K, Rohrer SG, Matz M, Kossner M, Diederich S, Maisner A, Schmitz J, Hiltensperger G, Baumann K, Holzgrabe U, Schneider-Schaulies J.. (2009) A small-molecule inhibitor of Nipah virus envelope protein-mediated membrane fusion., 52 (14): [PMID:19499921 ] [10.1021/jm900411s ]