The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-[4-(3-aminopropoxy)-3-bromophenyl]-2-hydroxyimino-N-[2-(1H-indol-3-yl)ethyl]propanamide hydrochloride ID: ALA558971
Max Phase: Preclinical
Molecular Formula: C22H26BrClN4O3
Molecular Weight: 473.37
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cl.NCCCOc1ccc(C/C(=N/O)C(=O)NCCc2c[nH]c3ccccc23)cc1Br
Standard InChI: InChI=1S/C22H25BrN4O3.ClH/c23-18-12-15(6-7-21(18)30-11-3-9-24)13-20(27-29)22(28)25-10-8-16-14-26-19-5-2-1-4-17(16)19;/h1-2,4-7,12,14,26,29H,3,8-11,13,24H2,(H,25,28);1H/b27-20-;
Standard InChI Key: BFJNITIQXYHKER-HNKVEKQCSA-N
Molfile:
RDKit 2D
31 32 0 0 0 0 0 0 0 0999 V2000
15.7648 7.0318 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
7.4549 10.3721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9224 10.6823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9249 9.5665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4598 8.1405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9923 7.8301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9898 8.9460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5241 6.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0553 6.0958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5870 4.6698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0564 7.2160 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8813 6.9729 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1182 4.3614 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3875 3.7758 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6500 2.9355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1812 2.6271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6529 11.2647 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
9.3907 12.1083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8595 12.4166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3277 13.8425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7966 14.1509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1710 15.2910 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
2 7 1 0
6 7 2 0
6 8 1 0
8 9 1 0
9 10 1 0
9 11 2 0
11 12 1 0
10 13 1 0
10 14 2 0
13 15 1 0
15 16 1 0
2 17 1 0
3 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
16 23 1 0
23 25 2 0
24 25 1 0
23 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
24 31 1 0
26 31 2 0
30 31 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 473.37Molecular Weight (Monoisotopic): 472.1110AlogP: 3.39#Rotatable Bonds: 10Polar Surface Area: 112.73Molecular Species: BASEHBA: 5HBD: 4#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.77CX Basic pKa: 9.97CX LogP: 2.29CX LogD: 1.18Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.16Np Likeness Score: 0.02
References 1. Zhu G, Yang F, Balachandran R, Höök P, Vallee RB, Curran DP, Day BW.. (2006) Synthesis and biological evaluation of purealin and analogues as cytoplasmic dynein heavy chain inhibitors., 49 (6): [PMID:16539395 ] [10.1021/jm051030l ]