The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
halisulfate 9 ID: ALA560361
PubChem CID: 10368315
Max Phase: Preclinical
Molecular Formula: C25H40O6S
Molecular Weight: 468.66
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Halisulfate 9 | halisulfate 9|CHEMBL560361
Synonyms from Alternative Forms(1): Halisulphate 9
Canonical SMILES: C[C@H]1CC[C@H]2C(=CCCC2(C)C)[C@@]1(C)CCC(CCCC1=CC(=O)OC1)COS(=O)(=O)O
Standard InChI: InChI=1S/C25H40O6S/c1-18-10-11-21-22(9-6-13-24(21,2)3)25(18,4)14-12-19(17-31-32(27,28)29)7-5-8-20-15-23(26)30-16-20/h9,15,18-19,21H,5-8,10-14,16-17H2,1-4H3,(H,27,28,29)/t18-,19?,21-,25-/m0/s1
Standard InChI Key: NFFYCHHMRWODEA-KYQCUNBSSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
6.0833 -2.2458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0833 -3.0708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7954 -3.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7954 -1.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5074 -2.2458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5084 -3.0708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2195 -3.4801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9340 -3.0690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9330 -2.2440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2174 -1.8301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3750 -4.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2000 -4.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6473 -1.8313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2125 -2.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2125 -1.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9245 -0.5875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9197 0.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6317 0.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2028 0.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1979 1.4708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4810 1.8791 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.7625 2.2917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0715 1.1629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8906 2.5952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3486 0.2459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0606 0.6626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7775 0.2543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8681 -0.5628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6760 -0.7296 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0843 -0.0127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5286 0.5970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9043 0.0785 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5042 -3.8917 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
15 16 1 0
5 4 2 0
16 17 1 0
5 10 1 0
17 18 1 0
6 7 1 0
17 19 1 0
7 8 1 0
19 20 1 0
8 9 1 0
20 21 1 0
9 10 1 0
21 22 1 0
5 6 1 0
21 23 2 0
3 11 1 0
21 24 2 0
18 25 1 0
3 12 1 0
25 26 1 0
1 2 1 0
26 27 1 0
27 28 1 0
9 13 1 1
1 4 1 0
10 14 1 6
2 3 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 27 2 0
10 15 1 0
30 32 2 0
3 6 1 0
6 33 1 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 468.66Molecular Weight (Monoisotopic): 468.2546AlogP: 5.65#Rotatable Bonds: 10Polar Surface Area: 89.90Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: -1.27CX Basic pKa: ┄CX LogP: 5.80CX LogD: 3.16Aromatic Rings: ┄Heavy Atoms: 32QED Weighted: 0.25Np Likeness Score: 3.19
References 1. Yao G, Kondratyuk TP, Tan GT, Pezzuto JM, Chang LC.. (2009) Bioactive sulfated sesterterpene alkaloids and sesterterpene sulfates from the marine sponge Fasciospongia sp., 72 (2): [PMID:19178162 ] [10.1021/np8005343 ]