N-(4-Aminobenzyl)-1-ethyl-4-oxo-6-(trifluoromethyl)-1,4-dihydroquinoline-3-carboxamide

ID: ALA562298

PubChem CID: 44190838

Max Phase: Preclinical

Molecular Formula: C20H18F3N3O2

Molecular Weight: 389.38

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCn1cc(C(=O)NCc2ccc(N)cc2)c(=O)c2cc(C(F)(F)F)ccc21

Standard InChI:  InChI=1S/C20H18F3N3O2/c1-2-26-11-16(19(28)25-10-12-3-6-14(24)7-4-12)18(27)15-9-13(20(21,22)23)5-8-17(15)26/h3-9,11H,2,10,24H2,1H3,(H,25,28)

Standard InChI Key:  MUXKPUPPRLULDH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
    2.4449  -10.9559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4449  -11.7809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1594  -12.1934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1594  -10.5434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8739  -10.9559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8739  -11.7809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5883  -12.1934    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3028  -11.7809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3028  -10.9559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5883  -10.5434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5883   -9.7184    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0173  -10.5434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7318  -10.9559    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0173   -9.7184    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5883  -13.0184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3028  -13.4309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4462  -10.5434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1607  -10.9559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8752  -10.5434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5896  -10.9559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5896  -11.7809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8752  -12.1934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1607  -11.7809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3041  -12.1934    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7305  -10.5434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0160  -10.1309    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.1430   -9.8289    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.3180  -11.2579    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  3  6  2  0
 12 14  2  0
  1  2  2  0
  7 15  1  0
  5  4  2  0
 15 16  1  0
  4  1  1  0
 13 17  1  0
  5 10  1  0
 17 18  1  0
  6  7  1  0
 18 19  2  0
  7  8  1  0
 19 20  1  0
  8  9  2  0
 20 21  2  0
  9 10  1  0
 21 22  1  0
  5  6  1  0
 22 23  2  0
 23 18  1  0
 10 11  2  0
 21 24  1  0
  1 25  1  0
  9 12  1  0
 25 26  1  0
  2  3  1  0
 25 27  1  0
 12 13  1  0
 25 28  1  0
M  END

Associated Targets(non-human)

G Glycoprotein G (19 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Vero (26788 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 389.38Molecular Weight (Monoisotopic): 389.1351AlogP: 3.55#Rotatable Bonds: 4
Polar Surface Area: 77.12Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.17CX LogP: 2.92CX LogD: 2.92
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.67Np Likeness Score: -1.46

References

1. Niedermeier S, Singethan K, Rohrer SG, Matz M, Kossner M, Diederich S, Maisner A, Schmitz J, Hiltensperger G, Baumann K, Holzgrabe U, Schneider-Schaulies J..  (2009)  A small-molecule inhibitor of Nipah virus envelope protein-mediated membrane fusion.,  52  (14): [PMID:19499921] [10.1021/jm900411s]

Source