The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-Aminobenzyl)-1-ethyl-4-oxo-6-(trifluoromethyl)-1,4-dihydroquinoline-3-carboxamide ID: ALA562298
PubChem CID: 44190838
Max Phase: Preclinical
Molecular Formula: C20H18F3N3O2
Molecular Weight: 389.38
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCn1cc(C(=O)NCc2ccc(N)cc2)c(=O)c2cc(C(F)(F)F)ccc21
Standard InChI: InChI=1S/C20H18F3N3O2/c1-2-26-11-16(19(28)25-10-12-3-6-14(24)7-4-12)18(27)15-9-13(20(21,22)23)5-8-17(15)26/h3-9,11H,2,10,24H2,1H3,(H,25,28)
Standard InChI Key: MUXKPUPPRLULDH-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
2.4449 -10.9559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4449 -11.7809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1594 -12.1934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1594 -10.5434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8739 -10.9559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8739 -11.7809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5883 -12.1934 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3028 -11.7809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3028 -10.9559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5883 -10.5434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5883 -9.7184 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0173 -10.5434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7318 -10.9559 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0173 -9.7184 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5883 -13.0184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3028 -13.4309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4462 -10.5434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1607 -10.9559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8752 -10.5434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5896 -10.9559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5896 -11.7809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8752 -12.1934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1607 -11.7809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3041 -12.1934 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7305 -10.5434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0160 -10.1309 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.1430 -9.8289 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.3180 -11.2579 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3 6 2 0
12 14 2 0
1 2 2 0
7 15 1 0
5 4 2 0
15 16 1 0
4 1 1 0
13 17 1 0
5 10 1 0
17 18 1 0
6 7 1 0
18 19 2 0
7 8 1 0
19 20 1 0
8 9 2 0
20 21 2 0
9 10 1 0
21 22 1 0
5 6 1 0
22 23 2 0
23 18 1 0
10 11 2 0
21 24 1 0
1 25 1 0
9 12 1 0
25 26 1 0
2 3 1 0
25 27 1 0
12 13 1 0
25 28 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 389.38Molecular Weight (Monoisotopic): 389.1351AlogP: 3.55#Rotatable Bonds: 4Polar Surface Area: 77.12Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 4.17CX LogP: 2.92CX LogD: 2.92Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.67Np Likeness Score: -1.46
References 1. Niedermeier S, Singethan K, Rohrer SG, Matz M, Kossner M, Diederich S, Maisner A, Schmitz J, Hiltensperger G, Baumann K, Holzgrabe U, Schneider-Schaulies J.. (2009) A small-molecule inhibitor of Nipah virus envelope protein-mediated membrane fusion., 52 (14): [PMID:19499921 ] [10.1021/jm900411s ]