The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
11-(2-chloro-6-fluorophenyl)-3-(furan-2-yl)-8-methyl-2,3,4,5,10,11-hexahydro-1H-dibenzo[b,e][1,4]diazepin-1-one ID: ALA562770
Max Phase: Preclinical
Molecular Formula: C24H20ClFN2O2
Molecular Weight: 422.89
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc2c(c1)NC(c1c(F)cccc1Cl)C1=C(CC(c3ccco3)CC1=O)N2
Standard InChI: InChI=1S/C24H20ClFN2O2/c1-13-7-8-17-18(10-13)28-24(22-15(25)4-2-5-16(22)26)23-19(27-17)11-14(12-20(23)29)21-6-3-9-30-21/h2-10,14,24,27-28H,11-12H2,1H3
Standard InChI Key: GNGGHMGWVRDRIC-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 34 0 0 0 0 0 0 0 0999 V2000
4.6079 -2.0806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0646 -4.6528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4226 -5.3961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9578 -6.0778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1351 -6.0161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7772 -5.2728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2419 -4.5912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8840 -3.8479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4715 -2.0406 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0590 -3.8479 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2148 -2.3985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3983 -3.2028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1867 -3.4460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7914 -2.8849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8195 -1.8374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5446 -3.2028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7282 -2.3985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1234 -1.8374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3350 -2.0806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1515 -2.8849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7562 -3.4460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6369 -3.1281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5293 -3.9712 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.8080 -3.9888 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9545 -5.2112 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5.2126 -1.5194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0221 -1.6789 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4239 -0.9583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8627 -0.3535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1141 -0.7003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12 13 1 0
13 14 1 0
14 1 1 0
1 15 1 0
7 8 1 0
4 5 2 0
16 17 2 0
17 9 1 0
17 18 1 0
9 11 1 0
18 19 2 0
19 20 1 0
16 10 1 0
20 21 2 0
21 16 1 0
12 8 1 0
20 22 1 0
10 8 1 0
2 23 1 0
11 12 2 0
13 24 2 0
5 6 1 0
6 25 1 0
3 4 1 0
1 26 1 0
29 30 1 0
6 7 2 0
27 28 1 0
7 2 1 0
2 3 2 0
11 15 1 0
26 27 1 0
28 29 2 0
30 26 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 422.89Molecular Weight (Monoisotopic): 422.1197AlogP: 6.36#Rotatable Bonds: 2Polar Surface Area: 54.27Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.30CX Basic pKa: 2.54CX LogP: 4.65CX LogD: 4.65Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.50Np Likeness Score: -1.25
References 1. Fu J, Shuttleworth SJ, Connors RV, Chai A, Coward P.. (2009) Discovery and optimization of a novel Neuromedin B receptor antagonist., 19 (15): [PMID:19553112 ] [10.1016/j.bmcl.2009.05.124 ]