The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3,4,5-trimethoxy-N-(6-(morpholinosulfonyl)benzo[d]thiazol-2-yl)benzamide ID: ALA563047
Cas Number: 706767-72-8
PubChem CID: 2017240
Max Phase: Preclinical
Molecular Formula: C21H23N3O7S2
Molecular Weight: 493.56
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C(=O)Nc2nc3ccc(S(=O)(=O)N4CCOCC4)cc3s2)cc(OC)c1OC
Standard InChI: InChI=1S/C21H23N3O7S2/c1-28-16-10-13(11-17(29-2)19(16)30-3)20(25)23-21-22-15-5-4-14(12-18(15)32-21)33(26,27)24-6-8-31-9-7-24/h4-5,10-12H,6-9H2,1-3H3,(H,22,23,25)
Standard InChI Key: BOQMKMYAQCBHSN-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
10.6128 -5.3845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6128 -6.2095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8983 -6.6220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8983 -4.9720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3273 -6.6220 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.0417 -7.0345 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7398 -5.9076 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9148 -7.3365 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1839 -5.3845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1839 -6.2095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3992 -6.4645 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.9143 -5.7970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3992 -5.1296 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0893 -5.7970 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6768 -6.5115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8518 -6.5115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0893 -7.2260 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4393 -7.2260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6143 -7.2260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2018 -6.5115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6143 -5.7970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4393 -5.7970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7562 -6.6220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4707 -7.0345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4707 -7.8595 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7562 -8.2720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0417 -7.8595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2018 -5.0826 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6143 -4.3681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3768 -6.5115 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9643 -7.2260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2018 -7.9405 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3768 -7.9405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15 16 1 0
1 2 2 0
15 17 2 0
5 8 2 0
16 18 2 0
9 10 1 0
18 19 1 0
9 4 2 0
19 20 2 0
4 1 1 0
20 21 1 0
21 22 2 0
22 16 1 0
6 23 1 0
2 5 1 0
2 3 1 0
10 11 1 0
11 12 1 0
12 13 2 0
6 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
13 9 1 0
21 28 1 0
5 6 1 0
28 29 1 0
12 14 1 0
20 30 1 0
3 10 2 0
30 31 1 0
14 15 1 0
19 32 1 0
5 7 2 0
32 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 493.56Molecular Weight (Monoisotopic): 493.0977AlogP: 2.60#Rotatable Bonds: 7Polar Surface Area: 116.29Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.36CX Basic pKa: ┄CX LogP: 2.25CX LogD: 2.25Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.53Np Likeness Score: -2.02
References 1. Aiello D, Barnes MH, Biswas EE, Biswas SB, Gu S, Williams JD, Bowlin TL, Moir DT.. (2009) Discovery, characterization and comparison of inhibitors of Bacillus anthracis and Staphylococcus aureus replicative DNA helicases., 17 (13): [PMID:19477652 ] [10.1016/j.bmc.2009.05.014 ] 2. PubChem BioAssay data set, 3. PubChem BioAssay data set,