The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
halisulfate 7 ID: ALA563149
PubChem CID: 45269646
Max Phase: Preclinical
Molecular Formula: C25H40O5S
Molecular Weight: 452.66
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Halisulfate 7 | halisulfate 7|CHEMBL563149
Canonical SMILES: C[C@H]1CC[C@H]2C(=CCCC2(C)C)[C@@]1(C)CCC(CCCc1ccoc1)COS(=O)(=O)O
Standard InChI: InChI=1S/C25H40O5S/c1-19-10-11-22-23(9-6-14-24(22,2)3)25(19,4)15-12-20(18-30-31(26,27)28)7-5-8-21-13-16-29-17-21/h9,13,16-17,19-20,22H,5-8,10-12,14-15,18H2,1-4H3,(H,26,27,28)/t19-,20?,22-,25-/m0/s1
Standard InChI Key: OYRXLPLXKXDHJP-NOIKYAEYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
16.8917 -7.6125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8917 -8.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6037 -8.8458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6037 -7.1958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3157 -7.6125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3122 -8.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0210 -8.8507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7378 -8.4435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7413 -7.6186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0280 -7.2007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3042 -9.2583 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
20.4579 -7.2098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0303 -6.3758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7460 -5.9653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7483 -5.1403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1833 -9.5583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8125 -9.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4640 -4.7298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0351 -4.7258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3194 -5.1362 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.6061 -4.7217 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.8875 -4.3083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0191 -4.0075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1967 -5.4379 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.1773 -5.1444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8929 -4.7339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6062 -5.1485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6882 -5.9671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4947 -6.1409 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.9092 -5.4276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3589 -4.8130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7375 -6.7833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 6 1 0
3 16 1 0
5 4 2 0
3 17 1 0
5 10 1 0
15 18 1 0
6 7 1 0
15 19 1 0
7 8 1 0
19 20 1 0
8 9 1 0
20 21 1 0
9 10 1 0
21 22 1 0
5 6 1 0
21 23 2 0
6 11 1 1
21 24 2 0
18 25 1 0
9 12 1 1
25 26 1 0
1 2 1 0
26 27 1 0
27 28 2 0
10 13 1 0
1 4 1 0
13 14 1 0
2 3 1 0
28 29 1 0
29 30 1 0
30 31 2 0
31 27 1 0
14 15 1 0
10 32 1 6
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.66Molecular Weight (Monoisotopic): 452.2596AlogP: 6.62#Rotatable Bonds: 10Polar Surface Area: 76.74Molecular Species: ACIDHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: -1.50CX Basic pKa: ┄CX LogP: 5.17CX LogD: 4.27Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.32Np Likeness Score: 2.77
References 1. Yao G, Kondratyuk TP, Tan GT, Pezzuto JM, Chang LC.. (2009) Bioactive sulfated sesterterpene alkaloids and sesterterpene sulfates from the marine sponge Fasciospongia sp., 72 (2): [PMID:19178162 ] [10.1021/np8005343 ]