The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-Chloro-1-ethyl-6-fluoro-N-(4-methoxybenzyl)-4-oxo-1,4-dihydroquinoline-3-carboxamide ID: ALA563338
PubChem CID: 44190927
Max Phase: Preclinical
Molecular Formula: C20H18ClFN2O3
Molecular Weight: 388.83
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCn1cc(C(=O)NCc2ccc(OC)cc2)c(=O)c2cc(F)c(Cl)cc21
Standard InChI: InChI=1S/C20H18ClFN2O3/c1-3-24-11-15(19(25)14-8-17(22)16(21)9-18(14)24)20(26)23-10-12-4-6-13(27-2)7-5-12/h4-9,11H,3,10H2,1-2H3,(H,23,26)
Standard InChI Key: ZAKYLIVEGOFMPI-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 29 0 0 0 0 0 0 0 0999 V2000
2.8225 -2.5520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8225 -3.3770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5370 -3.7895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5370 -2.1395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2515 -2.5520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2515 -3.3770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9659 -3.7895 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6804 -3.3770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6804 -2.5520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9659 -2.1395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9659 -1.3145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3949 -2.1395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3949 -1.3145 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1094 -2.5520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9659 -4.6145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6804 -5.0270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1094 -0.9020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1094 -0.0770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3949 0.3355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3949 1.1605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1094 1.5730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8238 1.1605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8238 0.3355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1094 2.3980 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8238 2.8105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1081 -2.1395 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.1081 -3.7895 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
12 13 1 0
3 6 2 0
12 14 2 0
1 2 2 0
7 15 1 0
5 4 2 0
15 16 1 0
4 1 1 0
13 17 1 0
5 10 1 0
17 18 1 0
6 7 1 0
18 19 2 0
7 8 1 0
19 20 1 0
8 9 2 0
20 21 2 0
9 10 1 0
21 22 1 0
5 6 1 0
22 23 2 0
23 18 1 0
10 11 2 0
21 24 1 0
24 25 1 0
9 12 1 0
1 26 1 0
2 3 1 0
2 27 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 388.83Molecular Weight (Monoisotopic): 388.0990AlogP: 3.75#Rotatable Bonds: 5Polar Surface Area: 60.33Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.46CX LogD: 3.46Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.72Np Likeness Score: -1.54
References 1. Niedermeier S, Singethan K, Rohrer SG, Matz M, Kossner M, Diederich S, Maisner A, Schmitz J, Hiltensperger G, Baumann K, Holzgrabe U, Schneider-Schaulies J.. (2009) A small-molecule inhibitor of Nipah virus envelope protein-mediated membrane fusion., 52 (14): [PMID:19499921 ] [10.1021/jm900411s ]