(R,S)-diethyl 2-(1-(3,4-dimethoxyphenyl)-3-oxo-4-((2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)butyl)malonate

ID: ALA564635

PubChem CID: 45268037

Max Phase: Preclinical

Molecular Formula: C25H36O12

Molecular Weight: 528.55

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)C(C(=O)OCC)C(CC(=O)C[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)c1ccc(OC)c(OC)c1

Standard InChI:  InChI=1S/C25H36O12/c1-5-35-24(31)20(25(32)36-6-2)15(13-7-8-16(33-3)17(9-13)34-4)10-14(27)11-18-21(28)23(30)22(29)19(12-26)37-18/h7-9,15,18-23,26,28-30H,5-6,10-12H2,1-4H3/t15?,18-,19+,21-,22+,23+/m0/s1

Standard InChI Key:  ASLVIJCCFFAXMT-WIPWOYJKSA-N

Molfile:  

     RDKit          2D

 37 38  0  0  0  0  0  0  0  0999 V2000
   -1.1713  -11.8906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4596  -12.3031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2562  -11.8906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9679  -12.3031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4596  -13.1281    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6838  -11.8906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8872  -12.3031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8872  -13.1281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1713  -13.5406    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6031  -13.5406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6031  -14.3656    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3189  -13.1281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0306  -13.5406    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3189  -12.3031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6031  -11.8906    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0306  -11.8906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7465  -12.3031    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9669  -13.1281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3979  -12.3037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1127  -11.8918    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3972  -13.1287    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8269  -12.3049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5417  -11.8930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6845  -11.0656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3993  -10.6537    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9704  -10.6525    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1134  -11.0668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8282  -10.6549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2522  -13.5361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2508  -14.3603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9653  -14.7746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6826  -14.3585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6805  -13.5357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3980  -14.7694    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3999  -15.5944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9653  -15.5996    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2509  -16.0121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  6 19  1  0
  2  3  1  0
 19 20  1  0
  3  4  1  0
 19 21  2  0
  2  5  2  0
 20 22  1  0
  4  6  1  0
 22 23  1  0
  7  8  1  0
  6 24  1  0
  8  9  1  6
 24 25  1  0
  8 10  1  0
 24 26  2  0
 10 11  1  1
 25 27  1  0
 10 12  1  0
 27 28  1  0
 12 13  1  6
 18 29  2  0
 12 14  1  0
 29 30  1  0
 14 15  1  0
 30 31  2  0
 14 16  1  1
 31 32  1  0
 16 17  1  0
 32 33  2  0
 33 18  1  0
  7 15  1  0
 32 34  1  0
  7  1  1  1
 34 35  1  0
 31 36  1  0
  4 18  1  0
 36 37  1  0
M  END

Associated Targets(non-human)

Gaa Acidic alpha-glucosidase (551 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
G6pc1 Glucose-6-phosphatase (38 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Pygl Liver glycogen phosphorylase (81 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 528.55Molecular Weight (Monoisotopic): 528.2207AlogP: -0.28#Rotatable Bonds: 13
Polar Surface Area: 178.28Molecular Species: NEUTRALHBA: 12HBD: 4
#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.60CX Basic pKa: CX LogP: -0.35CX LogD: -0.35
Aromatic Rings: 1Heavy Atoms: 37QED Weighted: 0.19Np Likeness Score: 0.68

References

1. Bisht SS, Fatima S, Tamrakar AK, Rahuja N, Jaiswal N, Srivastava AK, Tripathi RP..  (2009)  Synthetic studies in butenonyl C-glycosides: Preparation of polyfunctional alkanonyl glycosides and their enzyme inhibitory activity.,  19  (10): [PMID:19362832] [10.1016/j.bmcl.2009.03.136]

Source