N-(Cyclopropylmethyl)-1-ethyl-4-oxo-6-(trifluoromethyl)-1,4-dihydroquinoline-3-carboxamide

ID: ALA565012

PubChem CID: 44190923

Max Phase: Preclinical

Molecular Formula: C17H17F3N2O2

Molecular Weight: 338.33

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCn1cc(C(=O)NCC2CC2)c(=O)c2cc(C(F)(F)F)ccc21

Standard InChI:  InChI=1S/C17H17F3N2O2/c1-2-22-9-13(16(24)21-8-10-3-4-10)15(23)12-7-11(17(18,19)20)5-6-14(12)22/h5-7,9-10H,2-4,8H2,1H3,(H,21,24)

Standard InChI Key:  NHJGNFGIGDCFNJ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
    2.9197  -13.6540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9197  -14.4790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6342  -14.8915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6342  -13.2415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3487  -13.6540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3487  -14.4790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0631  -14.8915    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7776  -14.4790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7776  -13.6540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0631  -13.2415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0631  -12.4165    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4921  -13.2415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4921  -12.4165    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2066  -13.6540    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0631  -15.7165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7776  -16.1290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2066  -12.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2066  -11.1790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2053  -13.2415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4908  -12.8290    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.7928  -13.9559    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.6178  -12.5270    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.6191  -10.4645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7941  -10.4645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  9 12  1  0
  2  3  1  0
 12 13  1  0
  3  6  2  0
 12 14  2  0
  1  2  2  0
  7 15  1  0
  5  4  2  0
 15 16  1  0
  4  1  1  0
 13 17  1  0
  5 10  1  0
 17 18  1  0
  6  7  1  0
  1 19  1  0
  7  8  1  0
 19 20  1  0
  8  9  2  0
 19 21  1  0
  9 10  1  0
 19 22  1  0
 23 18  1  0
 24 23  1  0
 18 24  1  0
  5  6  1  0
 10 11  2  0
M  END

Associated Targets(non-human)

G Glycoprotein G (19 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Vero (26788 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 338.33Molecular Weight (Monoisotopic): 338.1242AlogP: 3.18#Rotatable Bonds: 4
Polar Surface Area: 51.10Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 0.32CX LogP: 2.81CX LogD: 2.81
Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.93Np Likeness Score: -1.49

References

1. Niedermeier S, Singethan K, Rohrer SG, Matz M, Kossner M, Diederich S, Maisner A, Schmitz J, Hiltensperger G, Baumann K, Holzgrabe U, Schneider-Schaulies J..  (2009)  A small-molecule inhibitor of Nipah virus envelope protein-mediated membrane fusion.,  52  (14): [PMID:19499921] [10.1021/jm900411s]

Source