The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(5-(4-(Benzyloxy)phenyl)-3-(4-methylphenyl)-4,5-dihydro-1H-pyrazol-1-yl)-4-(4-chlorophenyl)thiazole ID: ALA565063
PubChem CID: 44225244
Max Phase: Preclinical
Molecular Formula: C32H26ClN3OS
Molecular Weight: 536.10
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(C2=NN(c3nc(-c4ccc(Cl)cc4)cs3)C(c3ccc(OCc4ccccc4)cc3)C2)cc1
Standard InChI: InChI=1S/C32H26ClN3OS/c1-22-7-9-24(10-8-22)29-19-31(26-13-17-28(18-14-26)37-20-23-5-3-2-4-6-23)36(35-29)32-34-30(21-38-32)25-11-15-27(33)16-12-25/h2-18,21,31H,19-20H2,1H3
Standard InChI Key: YRZORSOZCOBDCR-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
0.7387 -1.8333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1256 -2.3853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2971 -3.1923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0818 -3.4472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6949 -2.8952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5233 -2.0882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4795 -3.1501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0926 -2.5981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8772 -2.8530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4903 -2.3010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2749 -2.5559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4464 -3.3629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8333 -3.9149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0487 -3.6600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2311 -3.6179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4860 -4.4025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3110 -4.4025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5659 -3.6179 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8985 -3.1329 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7959 -5.0699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6164 -4.9837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1013 -5.6511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7658 -6.4048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9453 -6.4910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4604 -5.8236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8985 -2.3079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2311 -1.8230 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.4860 -1.0384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3110 -1.0384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5659 -1.8230 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2507 -7.0722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7959 -0.3709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4604 0.3827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9453 1.0502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7658 0.9639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1013 0.2103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6164 -0.4572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2507 1.6314 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
18 19 1 0
19 15 1 0
12 15 1 0
4 5 1 0
9 10 2 0
20 21 2 0
2 3 1 0
21 22 1 0
10 11 1 0
22 23 2 0
5 6 2 0
23 24 1 0
11 12 2 0
24 25 2 0
25 20 1 0
17 20 1 0
6 1 1 0
19 26 1 0
26 27 1 0
12 13 1 0
1 2 2 0
13 14 2 0
14 9 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 26 2 0
15 16 1 0
23 31 1 0
5 7 1 0
3 4 2 0
32 33 2 0
7 8 1 0
33 34 1 0
34 35 2 0
8 9 1 0
35 36 1 0
16 17 1 0
36 37 2 0
37 32 1 0
29 32 1 0
17 18 2 0
35 38 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 536.10Molecular Weight (Monoisotopic): 535.1485AlogP: 8.71#Rotatable Bonds: 7Polar Surface Area: 37.72Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 4.60CX LogP: 9.48CX LogD: 9.47Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.21Np Likeness Score: -1.51
References 1. el-Sabbagh OI, Baraka MM, Ibrahim SM, Pannecouque C, Andrei G, Snoeck R, Balzarini J, Rashad AA.. (2009) Synthesis and antiviral activity of new pyrazole and thiazole derivatives., 44 (9): [PMID:19419804 ] [10.1016/j.ejmech.2009.03.038 ]