The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-1-(beta-cellobiosyl)-4-(2-napthyl)but-3-en-2-one ID: ALA565071
PubChem CID: 45272310
Max Phase: Preclinical
Molecular Formula: C26H32O11
Molecular Weight: 520.53
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(/C=C/c1ccc2ccccc2c1)C[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O
Standard InChI: InChI=1S/C26H32O11/c27-11-18-21(31)22(32)24(34)26(36-18)37-25-19(12-28)35-17(20(30)23(25)33)10-16(29)8-6-13-5-7-14-3-1-2-4-15(14)9-13/h1-9,17-28,30-34H,10-12H2/b8-6+/t17-,18+,19+,20-,21+,22-,23+,24+,25+,26-/m0/s1
Standard InChI Key: GOMSLUFQDBATST-SJQYXZEFSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
10.5056 -6.1107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2201 -6.5232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9345 -6.1107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2201 -7.3482 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9345 -5.2857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6490 -4.8732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6490 -4.0482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3635 -3.6357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3635 -5.2857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0779 -4.8732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0779 -4.0482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7924 -3.6357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5069 -4.0482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5069 -4.8732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7924 -5.2857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6477 -7.7607 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9332 -7.3482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2188 -7.7607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2188 -8.5857 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5043 -7.3482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7898 -7.7607 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5043 -6.5232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7898 -6.1107 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2188 -6.1107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9332 -6.5232 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2188 -5.2857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9332 -4.8732 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3622 -7.3482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3622 -6.5232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0766 -6.1107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7911 -6.5232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7911 -7.3482 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0766 -7.7607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0766 -8.5857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7911 -8.9982 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6477 -6.9357 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.6477 -6.1107 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0766 -5.2857 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
10 11 1 0
5 6 1 0
11 12 1 0
1 2 1 0
12 13 2 0
17 18 1 0
18 19 1 6
18 20 1 0
20 21 1 1
20 22 1 0
22 23 1 6
22 24 1 0
24 25 1 0
24 26 1 1
26 27 1 0
17 25 1 0
17 16 1 1
6 7 2 0
28 16 1 1
28 29 1 0
13 14 1 0
2 4 2 0
14 15 2 0
15 10 1 0
7 8 1 0
28 33 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
8 11 2 0
33 34 1 6
34 35 1 0
10 9 2 0
28 36 1 6
9 6 1 0
29 37 1 6
3 5 2 0
30 38 1 1
31 1 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 520.53Molecular Weight (Monoisotopic): 520.1945AlogP: -1.52#Rotatable Bonds: 8Polar Surface Area: 186.37Molecular Species: NEUTRALHBA: 11HBD: 7#RO5 Violations: 3HBA (Lipinski): 11HBD (Lipinski): 7#RO5 Violations (Lipinski): 3CX Acidic pKa: 12.11CX Basic pKa: ┄CX LogP: -0.89CX LogD: -0.89Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.20Np Likeness Score: 1.41
References 1. Bisht SS, Fatima S, Tamrakar AK, Rahuja N, Jaiswal N, Srivastava AK, Tripathi RP.. (2009) Synthetic studies in butenonyl C-glycosides: Preparation of polyfunctional alkanonyl glycosides and their enzyme inhibitory activity., 19 (10): [PMID:19362832 ] [10.1016/j.bmcl.2009.03.136 ]