The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-{2-[4-(6-bromobenzo[1,3]dioxol-5-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethyl}-3-(3-iodo(125)-phenyl)urea ID: ALA569278
PubChem CID: 45486406
Max Phase: Preclinical
Molecular Formula: C28H25BrIN3O3
Molecular Weight: 658.33
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCCc1ccc2c(c1)[C@@H]1C=CC[C@@H]1[C@H](c1cc3c(cc1Br)OCO3)N2)Nc1cccc([125I])c1
Standard InChI: InChI=1S/C28H25BrIN3O3/c29-23-14-26-25(35-15-36-26)13-22(23)27-20-6-2-5-19(20)21-11-16(7-8-24(21)33-27)9-10-31-28(34)32-18-4-1-3-17(30)12-18/h1-5,7-8,11-14,19-20,27,33H,6,9-10,15H2,(H2,31,32,34)/t19-,20+,27-/m1/s1/i30-2
Standard InChI Key: ZAKNBQXENRAVAB-DBBOMHGISA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
-3.3458 -15.1208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6338 -15.5292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9218 -14.2958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9234 -15.1190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2125 -15.5302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4994 -15.1193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5018 -14.2930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2133 -13.8856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0587 -15.5349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7741 -15.1217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7666 -16.7717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0562 -16.3565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3400 -16.7660 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
-5.4867 -16.3604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4887 -15.5346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2752 -15.2812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.7664 -15.9506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2785 -16.6174 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.3481 -14.2919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6338 -13.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8056 -13.0722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6262 -12.9862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9614 -13.7401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9250 -13.4625 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.0667 -14.7000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.2114 -13.8782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9271 -14.2884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6403 -13.8737 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3561 -14.2839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3587 -15.1089 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0692 -13.8691 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7850 -14.2793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7832 -15.1053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4981 -15.5154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2123 -15.1005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2070 -14.2713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4915 -13.8649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9187 -13.8540 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
16 17 1 0
17 18 1 0
18 14 1 0
19 20 1 0
8 3 1 0
19 1 1 0
3 4 2 0
9 10 2 0
10 15 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 19 1 0
1 2 1 0
20 24 1 6
14 11 1 0
19 25 1 6
4 5 1 0
7 26 1 0
11 12 2 0
26 27 1 0
12 9 1 0
27 28 1 0
1 9 1 1
28 29 1 0
2 4 1 0
29 30 2 0
12 13 1 0
29 31 1 0
14 15 2 0
31 32 1 0
5 6 2 0
32 33 2 0
3 20 1 0
33 34 1 0
6 7 1 0
34 35 2 0
35 36 1 0
7 8 2 0
36 37 2 0
37 32 1 0
15 16 1 0
36 38 1 0
M ISO 1 38 125
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 658.33Molecular Weight (Monoisotopic): 657.0124AlogP: 6.97#Rotatable Bonds: 5Polar Surface Area: 71.62Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.33CX Basic pKa: 3.03CX LogP: 6.45CX LogD: 6.45Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.20Np Likeness Score: -0.91
References 1. Ramesh C, Nayak TK, Burai R, Dennis MK, Hathaway HJ, Sklar LA, Prossnitz ER, Arterburn JB.. (2010) Synthesis and characterization of iodinated tetrahydroquinolines targeting the G protein-coupled estrogen receptor GPR30., 53 (3): [PMID:20041667 ] [10.1021/jm9011802 ]