The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-chloro-N-(2-methoxy-4-{[4-(2-oxo-2Hchromen-3-yl)benzoyl]amino}phenyl)benzamide ID: ALA571500
PubChem CID: 2214613
Max Phase: Preclinical
Molecular Formula: C30H21ClN2O5
Molecular Weight: 524.96
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(NC(=O)c2ccc(-c3cc4ccccc4oc3=O)cc2)ccc1NC(=O)c1ccccc1Cl
Standard InChI: InChI=1S/C30H21ClN2O5/c1-37-27-17-21(14-15-25(27)33-29(35)22-7-3-4-8-24(22)31)32-28(34)19-12-10-18(11-13-19)23-16-20-6-2-5-9-26(20)38-30(23)36/h2-17H,1H3,(H,32,34)(H,33,35)
Standard InChI Key: XQGRLBREQBQTBH-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
-5.4014 -18.3916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4026 -19.2190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6878 -19.6319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6896 -17.9789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9742 -18.3880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9708 -19.2165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2556 -19.6255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5392 -19.2106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5426 -18.3821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2624 -17.9685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8294 -17.9674 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8236 -19.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8255 -20.4469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1108 -20.8574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3965 -20.4429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4014 -19.6136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1167 -19.2069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3197 -20.8525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3230 -21.6775 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0325 -20.4371 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7486 -20.8467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7506 -21.6719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4659 -22.0814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1796 -21.6660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1736 -20.8367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4578 -20.4309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8963 -22.0746 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6086 -21.6583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3252 -22.0670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6041 -20.8333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3267 -22.8927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0425 -23.3013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7557 -22.8849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7486 -22.0557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0322 -21.6508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0249 -20.8259 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.4688 -22.9064 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7558 -23.3215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15 18 1 0
6 7 1 0
18 19 2 0
7 8 2 0
18 20 1 0
8 9 1 0
20 21 1 0
9 10 1 0
21 22 2 0
5 6 1 0
22 23 1 0
9 11 2 0
23 24 2 0
24 25 1 0
8 12 1 0
25 26 2 0
26 21 1 0
2 3 1 0
24 27 1 0
12 13 2 0
27 28 1 0
3 6 2 0
28 29 1 0
13 14 1 0
28 30 2 0
1 2 2 0
29 31 2 0
14 15 2 0
31 32 1 0
5 4 2 0
32 33 2 0
15 16 1 0
33 34 1 0
4 1 1 0
34 35 2 0
35 29 1 0
16 17 2 0
35 36 1 0
17 12 1 0
23 37 1 0
5 10 1 0
37 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 524.96Molecular Weight (Monoisotopic): 524.1139AlogP: 6.63#Rotatable Bonds: 6Polar Surface Area: 97.64Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.08CX LogD: 6.08Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.24Np Likeness Score: -1.25
References 1. Gupta RK, Thakur TS, Desiraju GR, Tyagi JS.. (2009) Structure-based design of DevR inhibitor active against nonreplicating Mycobacterium tuberculosis., 52 (20): [PMID:19827833 ] [10.1021/jm900358q ]