The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-{4-[(4-chlorobenzyl)oxy]-3-methoxyphenyl}-N-(4-chloro-2,5-dimethoxyphenyl)acrylamide ID: ALA571713
PubChem CID: 45484038
Max Phase: Preclinical
Molecular Formula: C25H25Cl2NO5
Molecular Weight: 490.38
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(NC(=O)CCc2ccc(OCc3ccc(Cl)cc3)c(OC)c2)c(OC)cc1Cl
Standard InChI: InChI=1S/C25H25Cl2NO5/c1-30-22-14-20(23(31-2)13-19(22)27)28-25(29)11-7-16-6-10-21(24(12-16)32-3)33-15-17-4-8-18(26)9-5-17/h4-6,8-10,12-14H,7,11,15H2,1-3H3,(H,28,29)
Standard InChI Key: NDZJQDZKTAJEHO-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
8.8116 -4.6512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6355 -4.6523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0466 -3.9405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6350 -3.2271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8080 -3.2299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4005 -3.9423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5748 -3.9448 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
10.8723 -3.9407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2850 -4.6559 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1107 -4.6561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5200 -5.3720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3450 -5.3726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7589 -4.6571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3417 -3.9394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5181 -3.9424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1023 -3.2291 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5121 -2.5123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5846 -4.6561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9981 -5.3708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8238 -5.3699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2360 -4.6543 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.2375 -6.0845 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.0617 -4.6534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4704 -5.3679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2953 -5.3674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7083 -4.6512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2902 -3.9342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4666 -3.9383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0491 -3.2260 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.4572 -2.5082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5340 -4.6492 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
18.7082 -6.0816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.5332 -6.0812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15 16 1 0
3 8 1 0
16 17 1 0
13 18 1 0
8 9 1 0
18 19 1 0
4 5 1 0
19 20 1 0
9 10 1 0
20 21 1 0
2 3 1 0
20 22 2 0
10 11 2 0
21 23 1 0
5 6 2 0
23 24 2 0
11 12 1 0
24 25 1 0
6 1 1 0
25 26 2 0
12 13 2 0
26 27 1 0
1 2 2 0
27 28 2 0
28 23 1 0
13 14 1 0
28 29 1 0
6 7 1 0
29 30 1 0
14 15 2 0
15 10 1 0
3 4 2 0
26 31 1 0
25 32 1 0
32 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 490.38Molecular Weight (Monoisotopic): 489.1110AlogP: 6.17#Rotatable Bonds: 10Polar Surface Area: 66.02Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.25CX Basic pKa: ┄CX LogP: 5.79CX LogD: 5.79Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.37Np Likeness Score: -0.98
References 1. Gupta RK, Thakur TS, Desiraju GR, Tyagi JS.. (2009) Structure-based design of DevR inhibitor active against nonreplicating Mycobacterium tuberculosis., 52 (20): [PMID:19827833 ] [10.1021/jm900358q ]