The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[3-(Phenylsulfonyl)ureido]-5,6,7,8-tetrahydro-4Hcyclohepta[b]thiophene-3-carbohydrazide ID: ALA573057
PubChem CID: 24204388
Max Phase: Preclinical
Molecular Formula: C17H20N4O4S2
Molecular Weight: 408.51
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: NNC(=O)c1c(NC(=O)NS(=O)(=O)c2ccccc2)sc2c1CCCCC2
Standard InChI: InChI=1S/C17H20N4O4S2/c18-20-15(22)14-12-9-5-2-6-10-13(12)26-16(14)19-17(23)21-27(24,25)11-7-3-1-4-8-11/h1,3-4,7-8H,2,5-6,9-10,18H2,(H,20,22)(H2,19,21,23)
Standard InChI Key: OEOJRNQLBGYGKM-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 29 0 0 0 0 0 0 0 0999 V2000
-3.9225 1.5724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1779 1.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1153 0.7683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6064 0.1171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7804 0.1113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4386 1.5486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2582 0.7484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4414 0.6727 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.1170 1.4261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7329 1.9674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2928 1.4293 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1231 0.7168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9481 0.7208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2860 0.0004 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3640 0.0083 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.1890 0.0122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6031 -0.7024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4273 -0.6988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8372 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4169 0.7330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5941 0.7259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6620 -0.4317 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7708 -0.7042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7542 2.7921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0506 3.2229 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4790 3.1861 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1826 2.7553 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12 13 1 0
12 14 2 0
1 3 1 0
13 15 1 0
1 2 1 0
15 16 1 0
3 4 1 0
16 17 2 0
2 6 1 0
17 18 1 0
7 8 1 0
18 19 2 0
8 9 1 0
19 20 1 0
9 10 2 0
20 21 2 0
21 16 1 0
10 6 1 0
15 22 2 0
7 5 1 0
15 23 2 0
9 11 1 0
10 24 1 0
4 5 1 0
24 25 2 0
11 12 1 0
24 26 1 0
6 7 2 0
26 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 408.51Molecular Weight (Monoisotopic): 408.0926AlogP: 2.13#Rotatable Bonds: 4Polar Surface Area: 130.39Molecular Species: ACIDHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.60CX Basic pKa: 2.36CX LogP: 3.47CX LogD: 2.71Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.27Np Likeness Score: -1.96
References 1. El-Sherbeny MA, Abdel-Aziz AA, Ahmed MA.. (2010) Synthesis and antitumor evaluation of novel diarylsulfonylurea derivatives: molecular modeling applications., 45 (2): [PMID:19939520 ] [10.1016/j.ejmech.2009.11.014 ]