(1R,4aS,4bS,6aS,10aR,10bS,12aS)-methyl 10a-(acetoxymethyl)-1-formyl-4b,7,7,12a-tetramethyl-1,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12,12a-hexadecahydrochrysene-2-carboxylate

ID: ALA573138

PubChem CID: 25159225

Max Phase: Preclinical

Molecular Formula: C28H42O5

Molecular Weight: 458.64

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COC(=O)C1=CC[C@@H]2[C@](C)(CC[C@H]3[C@@]2(C)CC[C@H]2C(C)(C)CCC[C@@]23COC(C)=O)[C@H]1C=O

Standard InChI:  InChI=1S/C28H42O5/c1-18(30)33-17-28-13-7-12-25(2,3)21(28)10-15-27(5)22-9-8-19(24(31)32-6)20(16-29)26(22,4)14-11-23(27)28/h8,16,20-23H,7,9-15,17H2,1-6H3/t20-,21-,22+,23-,26+,27-,28+/m0/s1

Standard InChI Key:  ASDDNTIFAUVZTF-UAAQQQAZSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
    3.2375  -27.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2375  -27.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9495  -28.2750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9495  -26.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6615  -27.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6626  -27.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3736  -28.2760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0882  -27.8648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3715  -26.6260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0868  -27.0445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0947  -25.3901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8099  -25.8086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7997  -26.6376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5086  -27.0585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2322  -26.6552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5290  -25.4005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2399  -25.8286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6583  -28.6875    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3667  -27.4500    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6542  -26.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0792  -26.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8042  -24.9833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7917  -27.4625    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5292  -28.9875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3542  -28.9875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3649  -25.7978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9360  -25.8106    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9287  -24.9856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2105  -24.5795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6394  -24.5667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5396  -24.5756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2594  -24.1724    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9601  -25.4260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6687  -25.8484    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9715  -24.6011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6573  -26.6733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 16 17  1  0
  5  9  1  0
  6  7  1  0
  7  8  1  0
  6 18  1  6
  8 10  1  0
  9 19  1  6
  9 10  1  0
  5 20  1  1
  3  6  1  0
 10 21  1  1
  5  4  1  0
 12 22  1  1
  5  6  1  0
 13 23  1  6
  9 26  1  0
  3 24  1  0
 10 13  1  0
  3 25  1  0
 12 11  1  0
 11 26  1  0
 20 27  1  0
 12 13  1  0
 27 28  1  0
 28 29  1  0
  1  2  1  0
 28 30  2  0
  1  4  1  0
 16 31  1  1
  2  3  1  0
 31 32  2  0
 12 16  1  0
 17 33  1  0
 13 14  1  0
 33 34  1  0
 14 15  1  0
 33 35  2  0
 15 17  2  0
 34 36  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA573138

   methyl (1R,4aS,4bS,6aS,10aR,10bS,12aS)-10a-(acetyloxymethyl)-1-formyl-4b,7,7,12a-tetramethyl-1,4,4a,5,6,6a,8,9,10,10b,11,12-dodecahydrochrysene-2-carboxylate

Molecule Features

Natural Product: Yes

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 458.64

Molecular Weight (Monoisotopic): 458.3032

AlogP: 5.51

#Rotatable Bonds: 4

Polar Surface Area: 69.67

Molecular Species: NEUTRAL

HBA: 5

HBD: ┄

#RO5 Violations: 1

HBA (Lipinski): 5

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): 1

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: 4.83

CX LogD: 4.83

Aromatic Rings: ┄

Heavy Atoms: 33

QED Weighted: 0.41

Np Likeness Score: 2.59

References

1. Song J, Jeong W, Wang N, Lee HS, Sim CJ, Oh KB, Shin J..  (2008)  Scalarane sesterterpenes from the sponge Smenospongia sp.,  71  (11): [PMID:18973387] [10.1021/np8003694]

Source

Source(1):

• Scientific Literature