(1S,4aS,4bS,6aS,10aR,10bS,12aS)-methyl 10a-(acetoxymethyl)-1-formyl-4b,7,7,12a-tetramethyl-1,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12,12a-hexadecahydrochrysene-2-carboxylate

ID: ALA573363

PubChem CID: 25158955

Max Phase: Preclinical

Molecular Formula: C28H42O5

Molecular Weight: 458.64

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COC(=O)C1=CC[C@@H]2[C@](C)(CC[C@H]3[C@@]2(C)CC[C@H]2C(C)(C)CCC[C@@]23COC(C)=O)[C@@H]1C=O

Standard InChI:  InChI=1S/C28H42O5/c1-18(30)33-17-28-13-7-12-25(2,3)21(28)10-15-27(5)22-9-8-19(24(31)32-6)20(16-29)26(22,4)14-11-23(27)28/h8,16,20-23H,7,9-15,17H2,1-6H3/t20-,21+,22-,23+,26-,27+,28-/m1/s1

Standard InChI Key:  ASDDNTIFAUVZTF-GHVIDDCHSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   -4.4750  -27.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4750  -28.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7630  -28.5833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7630  -26.9333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0510  -27.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0499  -28.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3389  -28.5843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6243  -28.1732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3410  -26.9343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6257  -27.3528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6178  -25.6984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9026  -26.1169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9128  -26.9459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2039  -27.3669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5197  -26.9635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1835  -25.7089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5274  -26.1369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0542  -28.9958    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3458  -27.7583    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0583  -26.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6333  -26.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9083  -25.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9208  -27.7708    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1833  -29.2958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3583  -29.2958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3476  -26.1061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7765  -26.1189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7838  -25.2939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5020  -24.8878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0731  -24.8751    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1729  -24.8839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5469  -24.4807    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2476  -25.7344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9562  -26.1567    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2590  -24.9094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9448  -26.9816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 16 17  1  0
  5  9  1  0
  6  7  1  0
  7  8  1  0
  6 18  1  6
  8 10  1  0
  9 19  1  6
  9 10  1  0
  5 20  1  1
  3  6  1  0
 10 21  1  1
  5  4  1  0
 12 22  1  1
  5  6  1  0
 13 23  1  6
  9 26  1  0
  3 24  1  0
 10 13  1  0
  3 25  1  0
 12 11  1  0
 11 26  1  0
 20 27  1  0
 12 13  1  0
 27 28  1  0
 28 29  1  0
  1  2  1  0
 28 30  2  0
  1  4  1  0
 16 31  1  6
  2  3  1  0
 31 32  2  0
 12 16  1  0
 17 33  1  0
 13 14  1  0
 33 34  1  0
 14 15  1  0
 33 35  2  0
 15 17  2  0
 34 36  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA573363

   methyl (1S,4aS,4bS,6aS,10aR,10bS,12aS)-10a-(acetyloxymethyl)-1-formyl-4b,7,7,12a-tetramethyl-1,4,4a,5,6,6a,8,9,10,10b,11,12-dodecahydrochrysene-2-carboxylate

Molecule Features

Natural Product: Yes

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 458.64

Molecular Weight (Monoisotopic): 458.3032

AlogP: 5.51

#Rotatable Bonds: 4

Polar Surface Area: 69.67

Molecular Species: NEUTRAL

HBA: 5

HBD: ┄

#RO5 Violations: 1

HBA (Lipinski): 5

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): 1

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: 4.83

CX LogD: 4.83

Aromatic Rings: ┄

Heavy Atoms: 33

QED Weighted: 0.41

Np Likeness Score: 2.59

References

1. Song J, Jeong W, Wang N, Lee HS, Sim CJ, Oh KB, Shin J..  (2008)  Scalarane sesterterpenes from the sponge Smenospongia sp.,  71  (11): [PMID:18973387] [10.1021/np8003694]

Source

Source(1):

• Scientific Literature