The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-(4-(4,6-bis(phenylamino)-1,3,5-triazin-2-ylamino)phenyl)-5-(4-nitrophenyl)-4,5-dihydro-1H-pyrazol-1-yl)ethanone ID: ALA574054
PubChem CID: 45113024
Max Phase: Preclinical
Molecular Formula: C32H27N9O3
Molecular Weight: 585.63
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)N1N=C(c2ccc(Nc3nc(Nc4ccccc4)nc(Nc4ccccc4)n3)cc2)CC1c1ccc([N+](=O)[O-])cc1
Standard InChI: InChI=1S/C32H27N9O3/c1-21(42)40-29(23-14-18-27(19-15-23)41(43)44)20-28(39-40)22-12-16-26(17-13-22)35-32-37-30(33-24-8-4-2-5-9-24)36-31(38-32)34-25-10-6-3-7-11-25/h2-19,29H,20H2,1H3,(H3,33,34,35,36,37,38)
Standard InChI Key: IZYIKPZPTUNLEY-UHFFFAOYSA-N
Molfile:
RDKit 2D
44 49 0 0 0 0 0 0 0 0999 V2000
9.3854 -15.1582 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3843 -15.9863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0997 -16.3995 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8167 -15.9858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8139 -15.1546 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0979 -14.7451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0954 -13.9194 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8093 -13.5045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5234 -13.9176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2367 -13.5033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2347 -12.6767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5133 -12.2663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8030 -12.6829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6689 -16.3986 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5325 -16.3976 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2468 -15.9835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9541 -15.9851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9552 -15.1596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2413 -14.7463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5250 -15.1586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5270 -15.9885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2414 -16.3982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9591 -16.3958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6731 -15.9824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6722 -15.1558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9515 -14.7443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2405 -15.1599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8990 -12.1888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6843 -12.4437 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1695 -11.7757 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.6834 -11.1080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8989 -11.3631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9952 -11.7755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4081 -12.4904 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4078 -11.0604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0948 -10.3969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9215 -10.3982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3343 -9.6839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9213 -8.9680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0914 -8.9707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6824 -9.6854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3347 -8.2465 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.9208 -7.5320 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.1604 -8.2453 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
21 22 2 0
22 17 1 0
10 11 2 0
16 23 2 0
5 6 2 0
23 24 1 0
11 12 1 0
24 25 2 0
6 1 1 0
25 26 1 0
12 13 2 0
26 27 2 0
27 16 1 0
28 29 2 0
13 8 1 0
1 2 2 0
2 14 1 0
6 7 1 0
4 15 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 28 1 0
11 28 1 0
3 4 2 0
30 33 1 0
15 16 1 0
33 34 2 0
7 8 1 0
33 35 1 0
14 17 1 0
36 37 2 0
17 18 2 0
37 38 1 0
8 9 2 0
38 39 2 0
18 19 1 0
39 40 1 0
4 5 1 0
40 41 2 0
41 36 1 0
31 36 1 0
19 20 2 0
9 10 1 0
20 21 1 0
42 43 2 0
42 44 1 0
39 42 1 0
M CHG 2 42 1 44 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 585.63Molecular Weight (Monoisotopic): 585.2237AlogP: 6.71#Rotatable Bonds: 9Polar Surface Area: 150.57Molecular Species: NEUTRALHBA: 10HBD: 3#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 3#RO5 Violations (Lipinski): 3CX Acidic pKa: 12.21CX Basic pKa: 4.25CX LogP: 7.08CX LogD: 7.08Aromatic Rings: 5Heavy Atoms: 44QED Weighted: 0.13Np Likeness Score: -1.10
References 1. Solankee A, Kapadia K, Ana Cirić, Soković M, Doytchinova I, Geronikaki A.. (2010) Synthesis of some new S-triazine based chalcones and their derivatives as potent antimicrobial agents., 45 (2): [PMID:19926364 ] [10.1016/j.ejmech.2009.10.037 ]