The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-hydroxy-2,2-bis(4-(methylsulfonamido)phenyl)acetamide ID: ALA574378
PubChem CID: 45482635
Max Phase: Preclinical
Molecular Formula: C16H19N3O6S2
Molecular Weight: 413.48
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CS(=O)(=O)Nc1ccc(C(C(=O)NO)c2ccc(NS(C)(=O)=O)cc2)cc1
Standard InChI: InChI=1S/C16H19N3O6S2/c1-26(22,23)18-13-7-3-11(4-8-13)15(16(20)17-21)12-5-9-14(10-6-12)19-27(2,24)25/h3-10,15,18-19,21H,1-2H3,(H,17,20)
Standard InChI Key: NDCGISZPOIMWEF-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 28 0 0 0 0 0 0 0 0999 V2000
14.7555 -23.3271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4684 -23.7401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1878 -23.3266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1846 -22.4955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9026 -23.7384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9034 -24.5634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1880 -24.9741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1885 -25.7983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6164 -24.9705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7567 -22.4995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4624 -22.0844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6202 -25.7934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9060 -26.2138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6167 -23.3253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3316 -23.7371 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.6159 -22.5003 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0456 -23.3239 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0409 -22.0894 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0381 -21.2644 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.3222 -20.8543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4421 -20.5471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7446 -21.6746 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9090 -27.0386 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.1960 -27.4538 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.1989 -28.2788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7759 -26.7346 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4779 -27.8575 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10 1 2 0
5 6 1 0
5 14 1 0
2 3 2 0
14 15 1 0
6 7 2 0
14 16 2 0
15 17 1 0
7 8 1 0
10 18 1 0
8 13 2 0
18 19 1 0
3 4 1 0
19 20 1 0
12 9 2 0
19 21 2 0
9 6 1 0
19 22 2 0
10 11 1 0
13 23 1 0
4 11 2 0
23 24 1 0
1 2 1 0
24 25 1 0
12 13 1 0
24 26 2 0
3 5 1 0
24 27 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 413.48Molecular Weight (Monoisotopic): 413.0715AlogP: 1.07#Rotatable Bonds: 7Polar Surface Area: 141.67Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.72CX Basic pKa: ┄CX LogP: -0.78CX LogD: -0.80Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.40Np Likeness Score: -0.75
References 1. Tessier P, Smil DV, Wahhab A, Leit S, Rahil J, Li Z, Déziel R, Besterman JM.. (2009) Diphenylmethylene hydroxamic acids as selective class IIa histone deacetylase inhibitors., 19 (19): [PMID:19699639 ] [10.1016/j.bmcl.2009.08.010 ]