Sulfobromophthalein

ID: ALA574431

Cas Number: 297-83-6

PubChem CID: 5345

Max Phase: Unknown

Molecular Formula: C20H10Br4O10S2

Molecular Weight: 794.04

Molecule Type: Small molecule

Names and Identifiers

Synonyms: Sulfobromophtalein | Sulfobromophthalein free acid | Sulfobromphthalein | Sulfobromophthalein|297-83-6|Sulphobromophthalein|4,5,6,7-tetrabromo-3',3''-disulfophenolphthalein|Sulfobromophtalein|Sulfobromphthalein|Sulphobromophthalein [BAN]|Sulfobromophthalein free acid|0C2P5QKL36|CHEMBL574431|CHEBI:63836|2-hydroxy-5-[4,5,6,7-tetrabromo-1-(4-hydroxy-3-sulfophenyl)-3-oxo-2-benzofuran-1-yl]benzenesulfonic acid|Sulphobromophthalein (BAN)|Benzenesulfonic acid, 3,3'-(4,5,6,7-tetrabromo-3-oxo-1(3H)-isobeShow More⌵

Synonyms from Alternative Forms(14): Sulphobromophthalein | Sulfobromophthalein sodium | Bromosulfalein | Bromsulphthalein | Bromthalein | Bsp sodium | Hepartest | Hepatestabrome | Hepatosulfalein | Sodium Bromsulphalein | Sodium bromsulphthalein | Sulfobromophthalein | Sulfobromopthalein sodium | Sulfobromphthalein sodium

Canonical SMILES:  O=C1OC(c2ccc(O)c(S(=O)(=O)O)c2)(c2ccc(O)c(S(=O)(=O)O)c2)c2c(Br)c(Br)c(Br)c(Br)c21

Standard InChI:  InChI=1S/C20H10Br4O10S2/c21-15-13-14(16(22)18(24)17(15)23)20(34-19(13)27,7-1-3-9(25)11(5-7)35(28,29)30)8-2-4-10(26)12(6-8)36(31,32)33/h1-6,25-26H,(H,28,29,30)(H,31,32,33)

Standard InChI Key:  OHTXTCNTQJFRIG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
    0.7843    0.7846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0699    1.1971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6446    0.7846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6446   -0.0404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0699   -0.4529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7843   -0.0404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4988   -0.4529    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    0.0699   -1.2779    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    1.4988    1.1971    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    0.0699    2.0221    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   -1.4292   -0.2953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9142    0.3721    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6842   -1.0799    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4292    1.0396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1794    1.3830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8518    0.9051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6020    1.2485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6796    2.0699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0071    2.5478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2570    2.2043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4297    2.4133    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2744    0.7706    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9469    0.2927    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7523    1.4431    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7965    0.0981    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2662    1.8483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8850    2.3939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7219    3.2026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9400    3.4657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3212    2.9202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4843    2.1114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7770    4.2745    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3408    3.7482    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9596    4.2938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7952    4.3670    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8864    3.1293    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  1  6  1  0
  9  1  1  0
  3  2  1  0
 10  2  1  0
  3  4  2  0
 14  3  1  0
  5  4  1  0
  4 11  1  0
  6  5  2  0
  8  5  1  0
  7  6  1  0
 11 12  1  0
 11 13  2  0
 14 12  1  0
 15 14  1  0
 26 14  1  0
 15 16  2  0
 15 20  1  0
 16 17  1  0
 17 18  2  0
 17 22  1  0
 18 19  1  0
 18 21  1  0
 19 20  2  0
 23 22  2  0
 24 22  1  0
 25 22  2  0
 26 27  2  0
 26 31  1  0
 27 28  1  0
 28 29  2  0
 28 33  1  0
 29 30  1  0
 29 32  1  0
 30 31  2  0
 34 33  2  0
 35 33  1  0
 36 33  2  0
M  END

Alternative Forms

1. Alternative Forms:

   

   ALA574431

   Bromosulfalein

2. Parent:

   

   ALA574431

   SULFOBROMOPHTHALEIN

Molecule Features

Natural Product: Yes

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: Yes

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 794.04

Molecular Weight (Monoisotopic): 789.6449

AlogP: 5.10

#Rotatable Bonds: 4

Polar Surface Area: 175.50

Molecular Species: ACID

HBA: 8

HBD: 4

#RO5 Violations: 2

HBA (Lipinski): 10

HBD (Lipinski): 4

#RO5 Violations (Lipinski): 2

CX Acidic pKa: -3.44

CX Basic pKa: ┄

CX LogP: 7.09

CX LogD: 2.34

Aromatic Rings: 3

Heavy Atoms: 36

QED Weighted: 0.12

Np Likeness Score: 0.33

References

1. Weber JE, Oakley AJ, Christ AN, Clark AG, Hayes JD, Hall R, Hume DA, Board PG, Smythe ML, Flanagan JU..  (2010)  Identification and characterisation of new inhibitors for the human hematopoietic prostaglandin D2 synthase.,  45  (2): [PMID:19939518] [10.1016/j.ejmech.2009.10.025]

2. PubChem BioAssay data set, 

3. Ekins S, Williams AJ, Xu JJ..  (2010)  A predictive ligand-based Bayesian model for human drug-induced liver injury.,  38  (12): [PMID:20843939] [10.1124/dmd.110.035113]

4. Kruhlak NL, Choi SS, Contrera JF, Weaver JL, Willard JM, Hastings KL, Sancilio LF..  (2008)  Development of a phospholipidosis database and predictive quantitative structure-activity relationship (QSAR) models.,  18  (2): [PMID:20020916] [10.1080/15376510701857262]

5. Friesema EC, Ganguly S, Abdalla A, Manning Fox JE, Halestrap AP, Visser TJ..  (2003)  Identification of monocarboxylate transporter 8 as a specific thyroid hormone transporter.,  278  (1): [PMID:12871948] [10.1074/jbc.m300909200]

6. Takeuchi K, Sugiura T, Umeda S, Matsubara K, Horikawa M, Nakamichi N, Silver DL, Ishiwata N, Kato Y..  (2011)  Pharmacokinetics and hepatic uptake of eltrombopag, a novel platelet-increasing agent.,  39  (6): [PMID:21422191] [10.1124/dmd.110.037960]

7. WHO Anatomical Therapeutic Chemical Classification, 

Source

Source(4):

• Scientific Literature
• PubChem BioAssays
• TP-search Transporter Database
• WHO Anatomical Therapeutic Chemical Classification