The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-chloro-2-(3-(4-chloro-2-methylphenyl)ureido)-3-(4-chlorophenoxy)benzenesulfonic acid ID: ALA575313
PubChem CID: 423151
Max Phase: Preclinical
Molecular Formula: C20H15Cl3N2O5S
Molecular Weight: 501.78
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: NSC-151179 | CHEMBL575313|NSC-151179|BDBM50300689|6-chloro-2-(3-(4-chloro-2-methylphenyl)ureido)-3-(4-chlorophenoxy)benzenesulfonic acid
Canonical SMILES: Cc1cc(Cl)ccc1NC(=O)Nc1c(Oc2ccc(Cl)cc2)ccc(Cl)c1S(=O)(=O)O
Standard InChI: InChI=1S/C20H15Cl3N2O5S/c1-11-10-13(22)4-8-16(11)24-20(26)25-18-17(30-14-5-2-12(21)3-6-14)9-7-15(23)19(18)31(27,28)29/h2-10H,1H3,(H2,24,25,26)(H,27,28,29)
Standard InChI Key: DRXBXQAFEIOKPV-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
12.1027 -1.2583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1016 -2.0857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8164 -2.4985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5328 -2.0852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5300 -1.2547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8146 -0.8455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8162 -3.3235 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.1016 -3.7359 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5306 -3.7362 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0194 -3.1098 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2480 -2.4966 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
11.3882 -0.8460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3880 -0.0210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1048 0.3894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1049 1.2136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3898 1.6268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6731 1.2097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6765 0.3868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3885 2.4518 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
11.3868 -2.4976 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6726 -2.0845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9578 -2.4965 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6733 -1.2595 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2437 -2.0834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2492 -1.2574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5359 -0.8444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8201 -1.2564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8221 -2.0857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5360 -2.4949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1054 -0.8443 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
8.5385 -3.3199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 4 2 0
15 16 2 0
7 8 1 0
16 17 1 0
17 18 2 0
18 13 1 0
7 9 2 0
16 19 1 0
4 5 1 0
2 20 1 0
7 10 2 0
20 21 1 0
2 3 1 0
21 22 1 0
4 11 1 0
21 23 2 0
5 6 2 0
22 24 1 0
1 12 1 0
24 25 2 0
6 1 1 0
25 26 1 0
12 13 1 0
26 27 2 0
1 2 2 0
27 28 1 0
13 14 2 0
28 29 2 0
29 24 1 0
3 7 1 0
27 30 1 0
14 15 1 0
29 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 501.78Molecular Weight (Monoisotopic): 499.9767AlogP: 6.64#Rotatable Bonds: 5Polar Surface Area: 104.73Molecular Species: ACIDHBA: 4HBD: 3#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: -2.53CX Basic pKa: ┄CX LogP: 4.61CX LogD: 4.40Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.34Np Likeness Score: -1.32
References 1. Miguet L, Zervosen A, Gerards T, Pasha FA, Luxen A, Distèche-Nguyen M, Thomas A.. (2009) Discovery of new inhibitors of resistant Streptococcus pneumoniae penicillin binding protein (PBP) 2x by structure-based virtual screening., 52 (19): [PMID:19746934 ] [10.1021/jm900625q ]