The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-(4,6-bis(phenylamino)-1,3,5-triazin-2-ylamino)phenyl)-3-(4-chlorophenyl)prop-2-en-1-one ID: ALA575556
PubChem CID: 45482972
Max Phase: Preclinical
Molecular Formula: C30H23ClN6O
Molecular Weight: 519.01
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(/C=C/c1ccc(Cl)cc1)c1ccc(Nc2nc(Nc3ccccc3)nc(Nc3ccccc3)n2)cc1
Standard InChI: InChI=1S/C30H23ClN6O/c31-23-16-11-21(12-17-23)13-20-27(38)22-14-18-26(19-15-22)34-30-36-28(32-24-7-3-1-4-8-24)35-29(37-30)33-25-9-5-2-6-10-25/h1-20H,(H3,32,33,34,35,36,37)/b20-13+
Standard InChI Key: NKKZKRKYUXAOME-DEDYPNTBSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
9.6454 -0.1541 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6442 -0.9816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3592 -1.3945 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0756 -0.9811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0727 -0.1505 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3574 0.2586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3549 1.0837 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0681 1.4985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7818 1.0856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4946 1.4996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4926 2.3255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7718 2.7358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0619 2.3194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2054 2.7412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9217 2.3317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2019 3.5663 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6344 2.7474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3508 2.3379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3524 1.5116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0679 1.1022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7816 1.5179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7753 2.3472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0594 2.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9293 -1.3935 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7908 -1.3925 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5047 -0.9789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2151 -0.9805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2162 -0.1555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5029 0.2575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7870 -0.1545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7890 -0.9839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5030 -1.3931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2166 -1.3907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9299 -0.9778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9291 -0.1518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2089 0.2594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4985 -0.1559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4984 1.1094 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
8 9 2 0
18 19 2 0
4 5 1 0
19 20 1 0
9 10 1 0
20 21 2 0
2 3 1 0
21 22 1 0
10 11 2 0
22 23 2 0
23 18 1 0
5 6 2 0
2 24 1 0
11 12 1 0
4 25 1 0
6 1 1 0
25 26 1 0
12 13 2 0
24 27 1 0
13 8 1 0
27 28 2 0
1 2 2 0
28 29 1 0
11 14 1 0
29 30 2 0
6 7 1 0
30 31 1 0
14 15 1 0
31 32 2 0
32 27 1 0
3 4 2 0
26 33 2 0
14 16 2 0
33 34 1 0
7 8 1 0
34 35 2 0
15 17 2 0
35 36 1 0
36 37 2 0
37 26 1 0
17 18 1 0
21 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 519.01Molecular Weight (Monoisotopic): 518.1622AlogP: 7.65#Rotatable Bonds: 9Polar Surface Area: 91.83Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.96CX Basic pKa: 4.19CX LogP: 8.73CX LogD: 8.73Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.14Np Likeness Score: -0.63
References 1. Solankee A, Kapadia K, Ana Cirić, Soković M, Doytchinova I, Geronikaki A.. (2010) Synthesis of some new S-triazine based chalcones and their derivatives as potent antimicrobial agents., 45 (2): [PMID:19926364 ] [10.1016/j.ejmech.2009.10.037 ]