The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
12-Deacetoxy-23-acetoxy-19-O-acetylscalarin ID: ALA576346
PubChem CID: 11166698
Max Phase: Preclinical
Molecular Formula: C27H40O5
Molecular Weight: 444.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)OC[C@]12CCCC(C)(C)[C@@H]1CC[C@@]1(C)[C@@H]3CC=C4C(=O)O[C@@H](O)[C@@H]4[C@@]3(C)CC[C@@H]12
Standard InChI: InChI=1S/C27H40O5/c1-16(28)31-15-27-12-6-11-24(2,3)18(27)9-13-25(4)19-8-7-17-21(23(30)32-22(17)29)26(19,5)14-10-20(25)27/h7,18-21,23,30H,6,8-15H2,1-5H3/t18-,19-,20-,21+,23+,25-,26-,27+/m0/s1
Standard InChI Key: NQUDADRZXBXFOV-JMJANOEMSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
-4.8958 -8.5958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8958 -9.4208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1838 -9.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1838 -8.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4718 -8.5958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4707 -9.4208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7597 -9.8301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0451 -9.4190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7618 -8.1801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0466 -8.5986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0387 -6.9442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3234 -7.3627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3336 -8.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6247 -8.6127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0989 -8.2093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6043 -6.9547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1066 -7.3828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7334 -6.8389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4099 -6.0746 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4170 -6.1470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8433 -5.4407 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6125 -7.7792 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-3.4750 -10.2417 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.7667 -9.0042 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-3.4792 -7.7708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7684 -7.3520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1973 -7.3647 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0542 -7.7708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3292 -6.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3417 -9.0167 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.6042 -10.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7792 -10.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2047 -6.5398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9228 -6.1337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4939 -6.1209 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5371 -7.0252 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16 17 1 0
5 9 1 0
6 7 1 0
7 8 1 0
8 10 1 0
9 10 1 0
17 18 1 0
18 19 1 0
19 20 1 0
16 20 1 0
3 6 1 0
20 21 1 6
5 4 1 0
16 22 1 6
5 6 1 0
6 23 1 6
9 26 1 0
9 24 1 6
10 13 1 0
5 25 1 1
12 11 1 0
11 26 1 0
25 27 1 0
12 13 1 0
10 28 1 1
12 29 1 1
1 2 1 0
13 30 1 6
1 4 1 0
3 31 1 0
2 3 1 0
3 32 1 0
12 16 1 0
27 33 1 0
13 14 1 0
33 34 1 0
14 15 1 0
33 35 2 0
15 17 2 0
18 36 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 444.61Molecular Weight (Monoisotopic): 444.2876AlogP: 5.02#Rotatable Bonds: 2Polar Surface Area: 72.83Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.93CX Basic pKa: ┄CX LogP: 4.73CX LogD: 4.73Aromatic Rings: ┄Heavy Atoms: 32QED Weighted: 0.61Np Likeness Score: 2.95
References 1. Rho JR, Lee HS, Shin HJ, Ahn JW, Kim JY, Sim CJ, Shin J.. (2004) New sesterterpenes from the sponge Smenospongia sp., 67 (10): [PMID:15497955 ] [10.1021/np040103l ] 2. Song J, Jeong W, Wang N, Lee HS, Sim CJ, Oh KB, Shin J.. (2008) Scalarane sesterterpenes from the sponge Smenospongia sp., 71 (11): [PMID:18973387 ] [10.1021/np8003694 ] 3. Hahn D, Won DH, Mun B, Kim H, Han C, Wang W, Chun T, Park S, Yoon D, Choi H, Nam SJ, Ekins M, Chin J, Kang H.. (2013) Cytotoxic scalarane sesterterpenes from a Korean marine sponge Psammocinia sp., 23 (8): [PMID:23489626 ] [10.1016/j.bmcl.2013.02.061 ]