The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(20R)-4,5-alpha-Epoxy-17-methyl-3-hydroxy-6-[11C]methoxy-alpha-17-dimethyl-alpha-(2-phenylethyl)-6,14-ethenomorphinan-7-methanol ID: ALA576534
PubChem CID: 45482641
Max Phase: Preclinical
Molecular Formula: C30H35NO4
Molecular Weight: 473.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN1CC[C@]23c4c5ccc(O)c4O[C@H]2[C@@]2(O[11CH3])C=C[C@@]3(C[C@@H]2[C@@](C)(O)CCc2ccccc2)[C@H]1C5
Standard InChI: InChI=1S/C30H35NO4/c1-27(33,12-11-19-7-5-4-6-8-19)22-18-28-13-14-30(22,34-3)26-29(28)15-16-31(2)23(28)17-20-9-10-21(32)25(35-26)24(20)29/h4-10,13-14,22-23,26,32-33H,11-12,15-18H2,1-3H3/t22-,23-,26-,27+,28-,29+,30-/m1/s1/i3-1
Standard InChI Key: ALOSAFNTVICCGI-LHUYAREBSA-N
Molfile:
RDKit 2D
38 44 0 0 0 0 0 0 0 0999 V2000
-4.0241 -8.7993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4223 -9.5238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9940 -10.2288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1678 -10.2105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2022 -8.7794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7702 -9.4852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9825 -8.0331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8114 -8.0526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5505 -8.7389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9521 -9.4646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5267 -10.1713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6980 -10.1584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2965 -9.4327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7236 -8.7198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1725 -10.7344 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5896 -8.8677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5854 -7.3647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8335 -7.3676 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9700 -9.0550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2781 -9.6171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5278 -9.4185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9275 -8.6976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9521 -10.1252 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7518 -8.6833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1515 -7.9625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9744 -7.9501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3741 -7.2301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9497 -6.5225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1213 -6.5394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7253 -7.2600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3902 -10.9517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1819 -10.8012 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4803 -11.5696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1082 -8.7011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1199 -10.8827 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.1615 -8.0309 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.1891 -6.8534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1082 -10.1416 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9 7 1 0
7 18 1 0
17 18 1 0
7 8 1 0
9 19 1 6
9 10 1 0
19 20 2 0
12 20 1 0
4 6 1 0
13 21 1 0
5 1 1 0
21 22 1 0
5 6 2 0
21 23 1 1
22 24 1 0
2 3 1 0
24 25 1 0
1 2 2 0
25 26 2 0
9 14 1 0
26 27 1 0
10 11 1 0
27 28 2 0
11 12 1 0
28 29 1 0
12 13 1 0
29 30 2 0
30 25 1 0
13 14 1 0
3 31 1 0
3 4 2 0
12 32 1 6
4 15 1 0
32 33 1 0
15 11 1 0
21 34 1 0
5 8 1 0
11 35 1 1
10 16 1 1
7 36 1 6
6 10 1 0
18 37 1 0
16 17 1 0
13 38 1 1
M ISO 1 33 11
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 473.61Molecular Weight (Monoisotopic): 473.2566AlogP: 4.00#Rotatable Bonds: 5Polar Surface Area: 62.16Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.21CX Basic pKa: 8.99CX LogP: 3.61CX LogD: 2.24Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.64Np Likeness Score: 1.66
References 1. Marton J, Schoultz BW, Hjørnevik T, Drzezga A, Yousefi BH, Wester HJ, Willoch F, Henriksen G.. (2009) Synthesis and evaluation of a full-agonist orvinol for PET-imaging of opioid receptors: [11C]PEO., 52 (18): [PMID:19694469 ] [10.1021/jm900892x ]