The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(2-(4-bromophenyl)hydrazinecarbonyl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-ylcarbamoyl)benzenesulfonamide ID: ALA576577
PubChem CID: 45112456
Max Phase: Preclinical
Molecular Formula: C23H23BrN4O4S2
Molecular Weight: 563.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1sc2c(c1C(=O)NNc1ccc(Br)cc1)CCCCC2)NS(=O)(=O)c1ccccc1
Standard InChI: InChI=1S/C23H23BrN4O4S2/c24-15-11-13-16(14-12-15)26-27-21(29)20-18-9-5-2-6-10-19(18)33-22(20)25-23(30)28-34(31,32)17-7-3-1-4-8-17/h1,3-4,7-8,11-14,26H,2,5-6,9-10H2,(H,27,29)(H2,25,28,30)
Standard InChI Key: QCJYYJIEIPCKRS-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
-2.1850 -4.8068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4404 -4.4604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3778 -5.6109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8689 -6.2620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0429 -6.2679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7011 -4.8306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5207 -5.6307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2961 -5.7065 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.6205 -4.9530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0046 -4.4118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4447 -4.9499 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8606 -5.6623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6856 -5.6584 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4515 -6.3788 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1015 -6.3709 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.9265 -6.3670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3406 -7.0815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1648 -7.0779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5747 -6.3610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1544 -5.6461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3316 -5.6532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3995 -6.8109 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5083 -7.0833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0167 -3.5871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6869 -3.1563 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7415 -3.1931 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4451 -3.6239 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1700 -3.2299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1876 -2.4048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9117 -2.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6163 -2.4417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5922 -3.2706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8677 -3.6608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3416 -2.0487 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
3 4 1 0
16 17 2 0
2 6 1 0
17 18 1 0
7 8 1 0
18 19 2 0
8 9 1 0
19 20 1 0
9 10 2 0
20 21 2 0
21 16 1 0
10 6 1 0
15 22 2 0
7 5 1 0
15 23 2 0
9 11 1 0
10 24 1 0
4 5 1 0
24 25 2 0
11 12 1 0
24 26 1 0
6 7 2 0
26 27 1 0
12 13 1 0
27 28 1 0
28 29 2 0
12 14 2 0
29 30 1 0
1 3 1 0
30 31 2 0
13 15 1 0
31 32 1 0
1 2 1 0
32 33 2 0
33 28 1 0
15 16 1 0
31 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 563.50Molecular Weight (Monoisotopic): 562.0344AlogP: 5.05#Rotatable Bonds: 6Polar Surface Area: 116.40Molecular Species: ACIDHBA: 6HBD: 4#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.57CX Basic pKa: ┄CX LogP: 6.82CX LogD: 5.88Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.25Np Likeness Score: -1.94
References 1. El-Sherbeny MA, Abdel-Aziz AA, Ahmed MA.. (2010) Synthesis and antitumor evaluation of novel diarylsulfonylurea derivatives: molecular modeling applications., 45 (2): [PMID:19939520 ] [10.1016/j.ejmech.2009.11.014 ]