The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(4-methyl-1H-indol-5-ylamino)-5-(5-(piperazin-1-ylmethyl)benzofuran-2-yl)nicotinonitrile ID: ALA583906
PubChem CID: 44626360
Max Phase: Preclinical
Molecular Formula: C28H26N6O
Molecular Weight: 462.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(Nc2c(C#N)cncc2-c2cc3cc(CN4CCNCC4)ccc3o2)ccc2[nH]ccc12
Standard InChI: InChI=1S/C28H26N6O/c1-18-22-6-7-32-25(22)4-3-24(18)33-28-21(14-29)15-31-16-23(28)27-13-20-12-19(2-5-26(20)35-27)17-34-10-8-30-9-11-34/h2-7,12-13,15-16,30,32H,8-11,17H2,1H3,(H,31,33)
Standard InChI Key: DHUPFOOXPODTRC-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 40 0 0 0 0 0 0 0 0999 V2000
10.4352 -7.6119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1666 -8.3945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7104 -9.0155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2418 -7.4510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6187 -8.0793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7867 -8.0688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5203 -8.8579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1896 -9.3539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8655 -8.8707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5854 -9.2746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5922 -10.0990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3099 -10.5036 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.0206 -10.0836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0091 -9.2548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2908 -8.8540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7143 -8.8355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4225 -8.4131 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2790 -8.0293 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.9872 -7.6069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7037 -8.0132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4113 -7.5914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9703 -6.7882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2483 -6.3898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8385 -5.5515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6751 -6.3641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3984 -6.7700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0073 -6.2061 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6579 -5.4537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3422 -8.4263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9027 -7.7286 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2887 -6.9972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8528 -6.3016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0282 -6.3290 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6415 -7.0584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0793 -7.7603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16 17 3 0
14 16 1 0
7 8 1 0
15 18 1 0
8 9 2 0
18 19 1 0
9 5 1 0
19 20 2 0
4 1 1 0
20 21 1 0
21 26 2 0
6 7 1 0
25 22 2 0
22 19 1 0
10 11 1 0
22 23 1 0
25 26 1 0
11 12 2 0
2 3 1 0
12 13 1 0
3 7 2 0
24 25 1 0
26 27 1 0
27 28 1 0
28 24 2 0
13 14 2 0
2 29 1 0
1 2 2 0
29 30 1 0
30 31 1 0
14 15 1 0
15 10 2 0
10 9 1 0
6 4 2 0
5 6 1 0
30 35 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 462.56Molecular Weight (Monoisotopic): 462.2168AlogP: 5.31#Rotatable Bonds: 5Polar Surface Area: 92.91Molecular Species: BASEHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.23CX LogP: 3.80CX LogD: 1.97Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.33Np Likeness Score: -0.87
References 1. Prashad AS, Wang D, Subrath J, Wu B, Lin M, Zhang MY, Kagan N, Lee J, Yang X, Brennan A, Chaudhary D, Xu X, Leung L, Wang J, Boschelli DH.. (2009) C-5 substituted heteroaryl-3-pyridinecarbonitriles as PKCtheta inhibitors: part II., 19 (19): [PMID:19703774 ] [10.1016/j.bmcl.2009.07.113 ]