The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1R,5R,7R)-3-benzyl-N-((S)-1-hydroxy-4-methylpentan-2-yl)-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxamide ID: ALA591948
PubChem CID: 46229319
Max Phase: Preclinical
Molecular Formula: C19H26N2O5
Molecular Weight: 362.43
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C[C@@H](CO)NC(=O)[C@@H]1O[C@H]2CN(Cc3ccccc3)C(=O)[C@@H]1O2
Standard InChI: InChI=1S/C19H26N2O5/c1-12(2)8-14(11-22)20-18(23)16-17-19(24)21(10-15(25-16)26-17)9-13-6-4-3-5-7-13/h3-7,12,14-17,22H,8-11H2,1-2H3,(H,20,23)/t14-,15+,16+,17+/m0/s1
Standard InChI Key: YLFMGINTBAGZCH-YLFCFFPRSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
16.6665 -8.8029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4625 -8.6010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1229 -9.0987 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3275 -9.5571 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.1484 -9.9222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7065 -10.2915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5169 -10.4509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8704 -10.3267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8810 -11.1516 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.5795 -9.9050 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.1208 -9.4958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5028 -9.5794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1098 -10.3047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2844 -10.3227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8914 -11.0472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3231 -11.7513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1520 -11.7263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5413 -11.0013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2109 -10.9511 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.2992 -10.3083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0083 -9.8867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7281 -10.2900 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.4583 -7.7750 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
17.5125 -11.2750 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
20.3098 -11.1333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0295 -11.5366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0401 -12.3615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7386 -11.1149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 7 1 0
13 14 2 0
6 7 1 0
14 15 1 0
1 4 1 0
15 16 2 0
16 17 1 0
3 5 1 0
17 18 2 0
18 13 1 0
8 9 2 0
6 19 2 0
8 10 1 0
10 20 1 0
5 8 1 1
20 21 1 0
2 3 1 0
21 22 1 0
7 11 1 0
2 23 1 1
2 11 1 0
7 24 1 1
4 6 1 0
20 25 1 6
4 12 1 0
25 26 1 0
1 2 1 0
26 27 1 0
12 13 1 0
26 28 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 362.43Molecular Weight (Monoisotopic): 362.1842AlogP: 0.66#Rotatable Bonds: 7Polar Surface Area: 88.10Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.96CX Basic pKa: ┄CX LogP: 1.20CX LogD: 1.20Aromatic Rings: 1Heavy Atoms: 26QED Weighted: 0.74Np Likeness Score: -0.06
References 1. Trabocchi A, Mannino C, Machetti F, De Bernardis F, Arancia S, Cauda R, Cassone A, Guarna A.. (2010) Identification of inhibitors of drug-resistant Candida albicans strains from a library of bicyclic peptidomimetic compounds., 53 (6): [PMID:20184325 ] [10.1021/jm901734u ] 2. Calugi C, Guarna A, Trabocchi A.. (2014) Identification of constrained peptidomimetic chemotypes as HIV protease inhibitors., 84 [PMID:25042102 ] [10.1016/j.ejmech.2014.07.049 ] 3. Innocenti R, Lenci E, Menchi G, Pupi A, Trabocchi A.. (2017) Design and synthesis of bicyclic acetals as Beta Secretase (BACE1) inhibitors., 25 (19): [PMID:28359674 ] [10.1016/j.bmc.2017.03.030 ]