2-(4-(5-(3-nitrophenoxy)-1,3-dioxoisoindolin-2-yl)phenoxy)acetic acid

ID: ALA594665

PubChem CID: 1342179

Max Phase: Preclinical

Molecular Formula: C22H14N2O8

Molecular Weight: 434.36

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)COc1ccc(N2C(=O)c3ccc(Oc4cccc([N+](=O)[O-])c4)cc3C2=O)cc1

Standard InChI:  InChI=1S/C22H14N2O8/c25-20(26)12-31-15-6-4-13(5-7-15)23-21(27)18-9-8-17(11-19(18)22(23)28)32-16-3-1-2-14(10-16)24(29)30/h1-11H,12H2,(H,25,26)

Standard InChI Key:  XVOFSSVDBVXAGX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   -3.1223  -12.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1234  -13.2523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4086  -13.6652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4104  -12.0122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6950  -12.4213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6902  -13.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9027  -13.4986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4208  -12.8271    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9105  -12.1614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6602  -11.3753    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6432  -14.2817    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4042  -12.8222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8368  -12.0126    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8370  -11.1876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1202  -10.7773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1201   -9.9531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8352   -9.5399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5519   -9.9570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5485  -10.7799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2715   -9.5475    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9844   -9.9627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2746   -8.7225    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8183  -13.5354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6425  -13.5309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0516  -12.8135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6305  -12.0991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8077  -12.1071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8766  -12.8075    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2839  -12.0901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1089  -12.0841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5163  -11.3667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5266  -12.7956    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  5  4  2  0
 15 16  1  0
  6  7  1  0
 16 17  2  0
  7  8  1  0
 17 18  1  0
  8  9  1  0
 18 19  2  0
 19 14  1  0
  9  5  1  0
  4  1  1  0
  9 10  2  0
 20 21  2  0
 20 22  1  0
 18 20  1  0
  5  6  1  0
 12 23  2  0
  7 11  2  0
 23 24  1  0
 24 25  2  0
  8 12  1  0
 25 26  1  0
  2  3  1  0
 26 27  2  0
 27 12  1  0
  1 13  1  0
 25 28  1  0
  3  6  2  0
 28 29  1  0
 13 14  1  0
 29 30  1  0
  1  2  2  0
 30 31  1  0
 14 15  2  0
 30 32  2  0
M  CHG  2  20   1  22  -1
M  END

Associated Targets(Human)

LPAR3 Tchem Lysophosphatidic acid receptor Edg-7 (471 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 434.36Molecular Weight (Monoisotopic): 434.0750AlogP: 3.65#Rotatable Bonds: 7
Polar Surface Area: 136.28Molecular Species: ACIDHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 2.85CX Basic pKa: CX LogP: 3.34CX LogD: -0.15
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.34Np Likeness Score: -1.20

References

1. Fells JI, Tsukahara R, Liu J, Tigyi G, Parrill AL..  (2009)  Structure-based drug design identifies novel LPA3 antagonists.,  17  (21): [PMID:19800804] [10.1016/j.bmc.2009.09.022]

Source