The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-(5-(3-nitrophenoxy)-1,3-dioxoisoindolin-2-yl)phenoxy)acetic acid ID: ALA594665
PubChem CID: 1342179
Max Phase: Preclinical
Molecular Formula: C22H14N2O8
Molecular Weight: 434.36
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)COc1ccc(N2C(=O)c3ccc(Oc4cccc([N+](=O)[O-])c4)cc3C2=O)cc1
Standard InChI: InChI=1S/C22H14N2O8/c25-20(26)12-31-15-6-4-13(5-7-15)23-21(27)18-9-8-17(11-19(18)22(23)28)32-16-3-1-2-14(10-16)24(29)30/h1-11H,12H2,(H,25,26)
Standard InChI Key: XVOFSSVDBVXAGX-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
-3.1223 -12.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1234 -13.2523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4086 -13.6652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4104 -12.0122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6950 -12.4213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6902 -13.2478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9027 -13.4986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4208 -12.8271 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9105 -12.1614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6602 -11.3753 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6432 -14.2817 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4042 -12.8222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8368 -12.0126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8370 -11.1876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1202 -10.7773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1201 -9.9531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8352 -9.5399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5519 -9.9570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5485 -10.7799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2715 -9.5475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.9844 -9.9627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2746 -8.7225 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8183 -13.5354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6425 -13.5309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0516 -12.8135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6305 -12.0991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8077 -12.1071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8766 -12.8075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2839 -12.0901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1089 -12.0841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5163 -11.3667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5266 -12.7956 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5 4 2 0
15 16 1 0
6 7 1 0
16 17 2 0
7 8 1 0
17 18 1 0
8 9 1 0
18 19 2 0
19 14 1 0
9 5 1 0
4 1 1 0
9 10 2 0
20 21 2 0
20 22 1 0
18 20 1 0
5 6 1 0
12 23 2 0
7 11 2 0
23 24 1 0
24 25 2 0
8 12 1 0
25 26 1 0
2 3 1 0
26 27 2 0
27 12 1 0
1 13 1 0
25 28 1 0
3 6 2 0
28 29 1 0
13 14 1 0
29 30 1 0
1 2 2 0
30 31 1 0
14 15 2 0
30 32 2 0
M CHG 2 20 1 22 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 434.36Molecular Weight (Monoisotopic): 434.0750AlogP: 3.65#Rotatable Bonds: 7Polar Surface Area: 136.28Molecular Species: ACIDHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 2.85CX Basic pKa: ┄CX LogP: 3.34CX LogD: -0.15Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.34Np Likeness Score: -1.20
References 1. Fells JI, Tsukahara R, Liu J, Tigyi G, Parrill AL.. (2009) Structure-based drug design identifies novel LPA3 antagonists., 17 (21): [PMID:19800804 ] [10.1016/j.bmc.2009.09.022 ]