The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3S,20R)-20-(Propylamino-ethyl)-pregn-7-en-3-ol ID: ALA595251
PubChem CID: 46225920
Max Phase: Preclinical
Molecular Formula: C26H45NO
Molecular Weight: 387.65
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCNCC[C@@H](C)[C@H]1CC[C@H]2C3=CC[C@H]4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C
Standard InChI: InChI=1S/C26H45NO/c1-5-15-27-16-12-18(2)22-8-9-23-21-7-6-19-17-20(28)10-13-25(19,3)24(21)11-14-26(22,23)4/h7,18-20,22-24,27-28H,5-6,8-17H2,1-4H3/t18-,19+,20+,22-,23+,24+,25+,26-/m1/s1
Standard InChI Key: WQHXMCZCMKJPHZ-QSNVUPPFSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
6.9707 -1.0261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9707 -0.2011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6866 0.2114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6866 -1.4386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3983 -1.0261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1142 -1.4386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8300 -1.0261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8300 -0.2011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5417 0.2114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3264 -0.0457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8153 0.6239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3271 1.2900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2938 2.1150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9888 2.5582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5417 1.0364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5417 1.8614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8300 1.4489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1142 1.0364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1142 0.2114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3983 -0.2011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3983 0.6239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1142 -0.6136 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.5417 -0.6136 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.5626 2.4970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2564 -1.4389 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7207 2.1776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1208 1.5083 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.3917 -1.8500 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.4163 2.6212 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1483 2.2405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8439 2.6841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5758 2.3035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
12 15 1 0
9 15 1 0
15 16 1 1
15 17 1 0
17 18 1 0
18 19 1 0
8 19 1 0
19 20 1 0
3 20 1 0
5 20 1 0
20 21 1 1
19 22 1 6
9 23 1 6
13 24 1 6
1 2 1 0
1 25 1 1
2 3 1 0
14 26 1 0
1 4 1 0
12 27 1 6
4 5 1 0
5 28 1 6
5 6 1 0
26 29 1 0
6 7 1 0
29 30 1 0
7 8 2 0
30 31 1 0
8 9 1 0
31 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 387.65Molecular Weight (Monoisotopic): 387.3501AlogP: 5.95#Rotatable Bonds: 6Polar Surface Area: 32.26Molecular Species: BASEHBA: 2HBD: 2#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 10.75CX LogP: 5.26CX LogD: 2.27Aromatic Rings: ┄Heavy Atoms: 28QED Weighted: 0.44Np Likeness Score: 2.38
References 1. Renard D, Perruchon J, Giera M, Müller J, Bracher F.. (2009) Side chain azasteroids and thiasteroids as sterol methyltransferase inhibitors in ergosterol biosynthesis., 17 (23): [PMID:19833521 ] [10.1016/j.bmc.2009.09.037 ]