The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3S,20S)-20-[(N-Butyl-N-methyl-amino)-methyl]-pregn-7-en-3-ol ID: ALA595931
PubChem CID: 46225913
Max Phase: Preclinical
Molecular Formula: C27H47NO
Molecular Weight: 401.68
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCN(C)C[C@@H](C)[C@H]1CC[C@H]2C3=CC[C@H]4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C
Standard InChI: InChI=1S/C27H47NO/c1-6-7-16-28(5)18-19(2)23-10-11-24-22-9-8-20-17-21(29)12-14-26(20,3)25(22)13-15-27(23,24)4/h9,19-21,23-25,29H,6-8,10-18H2,1-5H3/t19-,20+,21+,23-,24+,25+,26+,27-/m1/s1
Standard InChI Key: OMCXUIYUJXNAFB-SKCNUYALSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
-3.6626 -1.5511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6626 -0.7261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9467 -0.3136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9467 -1.9636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2350 -1.5511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5192 -1.9636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8033 -1.5511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8033 -0.7261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0916 -0.3136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6931 -0.5707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1820 0.0989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6938 0.7650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6605 1.5900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3555 2.0332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0916 0.5114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0916 1.3364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8033 0.9239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5192 0.5114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5192 -0.3136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2350 -0.7261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2350 0.0989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5192 -1.1386 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.0916 -1.1386 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.0708 1.9720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3769 -1.9639 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0874 1.6526 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4875 0.9833 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.2417 -2.3750 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.7830 2.0962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5150 1.7155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2106 2.1591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9425 1.7785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1237 0.8284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
12 15 1 0
9 15 1 0
15 16 1 1
15 17 1 0
17 18 1 0
18 19 1 0
8 19 1 0
19 20 1 0
3 20 1 0
5 20 1 0
20 21 1 1
19 22 1 6
9 23 1 6
13 24 1 6
1 2 1 0
1 25 1 1
2 3 1 0
14 26 1 0
1 4 1 0
12 27 1 6
4 5 1 0
5 28 1 6
5 6 1 0
26 29 1 0
6 7 1 0
29 30 1 0
7 8 2 0
30 31 1 0
8 9 1 0
31 32 1 0
9 10 1 0
26 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 401.68Molecular Weight (Monoisotopic): 401.3658AlogP: 6.29#Rotatable Bonds: 6Polar Surface Area: 23.47Molecular Species: BASEHBA: 2HBD: 1#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 10.54CX LogP: 5.72CX LogD: 2.73Aromatic Rings: ┄Heavy Atoms: 29QED Weighted: 0.53Np Likeness Score: 1.80
References 1. Renard D, Perruchon J, Giera M, Müller J, Bracher F.. (2009) Side chain azasteroids and thiasteroids as sterol methyltransferase inhibitors in ergosterol biosynthesis., 17 (23): [PMID:19833521 ] [10.1016/j.bmc.2009.09.037 ]