The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R,S)-S-Butyl-S-[(3S,20S)-(3-hydroxypregn-7-en-20-yl)-methyl]-S-methyl-sulfonium iodide ID: ALA596150
PubChem CID: 46225956
Max Phase: Preclinical
Molecular Formula: C27H47IOS
Molecular Weight: 419.74
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCC(C)[S+](C)C[C@@H](C)[C@H]1CC[C@H]2C3=CC[C@H]4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C.[I-]
Standard InChI: InChI=1S/C27H47OS.HI/c1-7-19(3)29(6)17-18(2)23-10-11-24-22-9-8-20-16-21(28)12-14-26(20,4)25(22)13-15-27(23,24)5;/h9,18-21,23-25,28H,7-8,10-17H2,1-6H3;1H/q+1;/p-1/t18-,19?,20+,21+,23-,24+,25+,26+,27-,29?;/m1./s1
Standard InChI Key: AQVRIAXECCTILR-APYATHRJSA-M
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
0.6125 -4.0333 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
-3.9001 -9.5177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9001 -8.6927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1842 -8.2802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1842 -9.9302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4725 -9.5177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7567 -9.9302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0408 -9.5177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0408 -8.6927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3291 -8.2802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4556 -8.5373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9445 -7.8677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4563 -7.2017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4230 -6.3766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1180 -5.9335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3291 -7.4552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3291 -6.6302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0408 -7.0427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7567 -7.4552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7567 -8.2802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4725 -8.6927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4725 -7.8677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7567 -9.1052 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.3291 -9.1052 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.3083 -5.9946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6144 -9.9305 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8499 -6.3141 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.2500 -6.9833 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.4792 -10.3417 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.5455 -5.8705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2775 -6.2511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9731 -5.8076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8862 -7.1383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5091 -5.0463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
13 16 1 0
10 16 1 0
16 17 1 1
16 18 1 0
18 19 1 0
19 20 1 0
9 20 1 0
20 21 1 0
4 21 1 0
6 21 1 0
21 22 1 1
20 23 1 6
10 24 1 6
14 25 1 6
2 26 1 1
2 3 1 0
15 27 1 0
3 4 1 0
13 28 1 6
2 5 1 0
6 29 1 6
5 6 1 0
27 30 1 0
6 7 1 0
30 31 1 0
7 8 1 0
31 32 1 0
8 9 2 0
9 10 1 0
27 33 1 0
10 11 1 0
30 34 1 0
M CHG 2 1 -1 27 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 419.74Molecular Weight (Monoisotopic): 419.3342AlogP: 6.61#Rotatable Bonds: 5Polar Surface Area: 20.23Molecular Species: NEUTRALHBA: 1HBD: 1#RO5 Violations: 1HBA (Lipinski): 1HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.11CX LogD: 5.11Aromatic Rings: ┄Heavy Atoms: 29QED Weighted: 0.39Np Likeness Score: 2.25
References 1. Renard D, Perruchon J, Giera M, Müller J, Bracher F.. (2009) Side chain azasteroids and thiasteroids as sterol methyltransferase inhibitors in ergosterol biosynthesis., 17 (23): [PMID:19833521 ] [10.1016/j.bmc.2009.09.037 ]