The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-benzhydryl-4-((2,4-dimethylphenyl)(phenyl)methyl)piperazine-1-carboxamide ID: ALA596944
PubChem CID: 11612860
Max Phase: Preclinical
Molecular Formula: C33H35N3O
Molecular Weight: 489.66
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(C(c2ccccc2)N2CCN(C(=O)NC(c3ccccc3)c3ccccc3)CC2)c(C)c1
Standard InChI: InChI=1S/C33H35N3O/c1-25-18-19-30(26(2)24-25)32(29-16-10-5-11-17-29)35-20-22-36(23-21-35)33(37)34-31(27-12-6-3-7-13-27)28-14-8-4-9-15-28/h3-19,24,31-32H,20-23H2,1-2H3,(H,34,37)
Standard InChI Key: QVLIXEZADCIAGA-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
1.0419 -8.3653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0419 -9.1903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3275 -9.6028 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3870 -9.1903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3870 -8.3653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3275 -7.9528 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3275 -10.4278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0419 -10.8403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3870 -10.8403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3275 -7.1278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0419 -6.7153 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3870 -6.7153 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3870 -5.8903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1015 -5.4778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3275 -5.4778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1015 -4.6528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8159 -4.2403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5304 -4.6528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5304 -5.4778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8159 -5.8903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3275 -4.6528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0419 -4.2403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7564 -4.6528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7564 -5.4778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0419 -5.8903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3870 -11.6653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1015 -12.0778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8159 -11.6653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8159 -10.8403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1015 -10.4278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7564 -10.4278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4709 -10.8403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4709 -11.6653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7564 -12.0778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0419 -11.6653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3275 -12.0778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5304 -12.0778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7 9 1 0
18 19 1 0
2 3 1 0
19 20 2 0
20 14 1 0
6 10 1 0
15 21 2 0
3 4 1 0
21 22 1 0
10 11 2 0
22 23 2 0
4 5 1 0
23 24 1 0
10 12 1 0
24 25 2 0
25 15 1 0
5 6 1 0
9 26 2 0
12 13 1 0
26 27 1 0
27 28 2 0
13 14 1 0
28 29 1 0
3 7 1 0
29 30 2 0
30 9 1 0
13 15 1 0
8 31 2 0
1 2 1 0
31 32 1 0
14 16 2 0
32 33 2 0
7 8 1 0
33 34 1 0
16 17 1 0
34 35 2 0
35 8 1 0
1 6 1 0
26 36 1 0
17 18 2 0
28 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 489.66Molecular Weight (Monoisotopic): 489.2780AlogP: 6.51#Rotatable Bonds: 6Polar Surface Area: 35.58Molecular Species: NEUTRALHBA: 2HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.47CX LogP: 7.20CX LogD: 6.86Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.34Np Likeness Score: -1.14
References 1. Pajouhesh H, Feng ZP, Ding Y, Zhang L, Pajouhesh H, Morrison JL, Belardetti F, Tringham E, Simonson E, Vanderah TW, Porreca F, Zamponi GW, Mitscher LA, Snutch TP.. (2010) Structure-activity relationships of diphenylpiperazine N-type calcium channel inhibitors., 20 (4): [PMID:20117000 ] [10.1016/j.bmcl.2010.01.008 ]