(N'1E,N'6E)-N'1,N'6-bis(2,4-dihydroxybenzylidene)adipohydrazide

ID: ALA597154

PubChem CID: 135555030

Max Phase: Preclinical

Molecular Formula: C20H22N4O6

Molecular Weight: 414.42

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Synonyms: ZINC 01878835

Canonical SMILES:  O=C(CCCCC(=O)N/N=C/c1ccc(O)cc1O)N/N=C/c1ccc(O)cc1O

Standard InChI:  InChI=1S/C20H22N4O6/c25-15-7-5-13(17(27)9-15)11-21-23-19(29)3-1-2-4-20(30)24-22-12-14-6-8-16(26)10-18(14)28/h5-12,25-28H,1-4H2,(H,23,29)(H,24,30)/b21-11+,22-12+

Standard InChI Key:  VTFWQVMCGXXZDV-XHQRYOPUSA-N

Molfile:  

     RDKit          2D

 30 31  0  0  0  0  0  0  0  0999 V2000
   -5.2183   -8.6259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2183   -9.4509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5038   -9.8634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7893   -9.4509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7893   -8.6259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5038   -8.2134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0748   -8.2134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3604   -8.6259    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6459   -8.2134    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9314   -8.6259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2170   -8.2134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9314   -9.4509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4975   -8.6259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2120   -8.2134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9265   -8.6259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6409   -8.2134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3554   -8.6259    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6409   -7.3884    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0699   -8.2134    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0699   -7.3884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7843   -6.9759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7843   -6.1509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4988   -5.7384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2133   -6.1509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2133   -6.9759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4988   -7.3884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4988   -8.2134    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9277   -5.7384    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0748   -9.8634    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9327   -9.8634    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 14 15  1  0
  3  4  2  0
 15 16  1  0
  7  8  2  0
 16 17  1  0
 16 18  2  0
  8  9  1  0
 17 19  1  0
  4  5  1  0
 19 20  2  0
  9 10  1  0
 20 21  1  0
  2  3  1  0
 21 22  2  0
 10 11  1  0
 22 23  1  0
  5  6  2  0
 23 24  2  0
 10 12  2  0
 24 25  1  0
  6  1  1  0
 25 26  2  0
 26 21  1  0
 11 13  1  0
 26 27  1  0
  1  2  2  0
 24 28  1  0
 13 14  1  0
  4 29  1  0
  5  7  1  0
  2 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA597154

    ---

Associated Targets(non-human)

Genome polyprotein (78 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 414.42Molecular Weight (Monoisotopic): 414.1539AlogP: 1.67#Rotatable Bonds: 9
Polar Surface Area: 163.84Molecular Species: NEUTRALHBA: 8HBD: 6
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.33CX Basic pKa: 1.52CX LogP: 1.94CX LogD: 1.89
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.21Np Likeness Score: -0.40

References

1. Podvinec M, Lim SP, Schmidt T, Scarsi M, Wen D, Sonntag LS, Sanschagrin P, Shenkin PS, Schwede T..  (2010)  Novel inhibitors of dengue virus methyltransferase: discovery by in vitro-driven virtual screening on a desktop computer grid.,  53  (4): [PMID:20108931] [10.1021/jm900776m]

Source