The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(N'1E,N'6E)-N'1,N'6-bis(2,4-dihydroxybenzylidene)adipohydrazide ID: ALA597154
PubChem CID: 135555030
Max Phase: Preclinical
Molecular Formula: C20H22N4O6
Molecular Weight: 414.42
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: ZINC 01878835
Canonical SMILES: O=C(CCCCC(=O)N/N=C/c1ccc(O)cc1O)N/N=C/c1ccc(O)cc1O
Standard InChI: InChI=1S/C20H22N4O6/c25-15-7-5-13(17(27)9-15)11-21-23-19(29)3-1-2-4-20(30)24-22-12-14-6-8-16(26)10-18(14)28/h5-12,25-28H,1-4H2,(H,23,29)(H,24,30)/b21-11+,22-12+
Standard InChI Key: VTFWQVMCGXXZDV-XHQRYOPUSA-N
Molfile:
RDKit 2D
30 31 0 0 0 0 0 0 0 0999 V2000
-5.2183 -8.6259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2183 -9.4509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5038 -9.8634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7893 -9.4509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7893 -8.6259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5038 -8.2134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0748 -8.2134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3604 -8.6259 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.6459 -8.2134 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9314 -8.6259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2170 -8.2134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9314 -9.4509 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4975 -8.6259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2120 -8.2134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9265 -8.6259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6409 -8.2134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3554 -8.6259 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6409 -7.3884 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0699 -8.2134 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0699 -7.3884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7843 -6.9759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7843 -6.1509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4988 -5.7384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2133 -6.1509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2133 -6.9759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4988 -7.3884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4988 -8.2134 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9277 -5.7384 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.0748 -9.8634 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.9327 -9.8634 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14 15 1 0
3 4 2 0
15 16 1 0
7 8 2 0
16 17 1 0
16 18 2 0
8 9 1 0
17 19 1 0
4 5 1 0
19 20 2 0
9 10 1 0
20 21 1 0
2 3 1 0
21 22 2 0
10 11 1 0
22 23 1 0
5 6 2 0
23 24 2 0
10 12 2 0
24 25 1 0
6 1 1 0
25 26 2 0
26 21 1 0
11 13 1 0
26 27 1 0
1 2 2 0
24 28 1 0
13 14 1 0
4 29 1 0
5 7 1 0
2 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 414.42Molecular Weight (Monoisotopic): 414.1539AlogP: 1.67#Rotatable Bonds: 9Polar Surface Area: 163.84Molecular Species: NEUTRALHBA: 8HBD: 6#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.33CX Basic pKa: 1.52CX LogP: 1.94CX LogD: 1.89Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.21Np Likeness Score: -0.40
References 1. Podvinec M, Lim SP, Schmidt T, Scarsi M, Wen D, Sonntag LS, Sanschagrin P, Shenkin PS, Schwede T.. (2010) Novel inhibitors of dengue virus methyltransferase: discovery by in vitro-driven virtual screening on a desktop computer grid., 53 (4): [PMID:20108931 ] [10.1021/jm900776m ]