(4R,5R)-5-(3-hydroxyphenyl)-4-(4-(2-methylbenzyloxy)benzoyl)-1-(pyridin-4-ylmethyl)pyrrolidine-2,3-dione

ID: ALA597358

PubChem CID: 1558458

Max Phase: Preclinical

Molecular Formula: C31H26N2O5

Molecular Weight: 506.56

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Synonyms: ZINC 01758620 | CHEMBL597358|ZINC 01758620|BDBM50481401

Canonical SMILES:  Cc1ccccc1COc1ccc(C(=O)[C@@H]2C(=O)C(=O)N(Cc3ccncc3)[C@H]2c2cccc(O)c2)cc1

Standard InChI:  InChI=1S/C31H26N2O5/c1-20-5-2-3-6-24(20)19-38-26-11-9-22(10-12-26)29(35)27-28(23-7-4-8-25(34)17-23)33(31(37)30(27)36)18-21-13-15-32-16-14-21/h2-17,27-28,34H,18-19H2,1H3/t27-,28+/m1/s1

Standard InChI Key:  GKLPPVHSFIVRLC-IZLXSDGUSA-N

Molfile:  

     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   10.9652  -14.5640    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.7822  -15.3677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3921  -15.9267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1812  -15.6790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3568  -14.8673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7455  -14.3118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7918  -16.2366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5783  -15.9839    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.2428  -16.4694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9103  -15.9872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6617  -15.2005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8368  -15.1952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3534  -14.5243    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1529  -14.5353    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7360  -15.9721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1625  -16.6803    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1388  -15.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9625  -15.2418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9423  -13.8176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1162  -13.8293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3610  -14.5240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7089  -14.5474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3436  -13.0972    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.1686  -13.0867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5741  -12.3663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3965  -12.3605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3817  -10.9321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5557  -10.9406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7978  -11.6443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1458  -11.6614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8131  -13.0722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2394  -17.2946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5215  -17.6986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2236  -18.9416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9422  -18.5311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5162  -18.5201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9493  -17.7034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7978  -18.9291    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 19 20  1  0
  4  5  1  0
  2  3  1  0
  5  6  2  0
 17 22  1  0
 18 21  1  0
 21 19  2  0
 20 22  2  0
  9 10  1  0
 19 23  1  0
 10 11  1  0
 23 24  1  0
 11 12  1  0
 24 25  1  0
 25 26  2  0
 12  8  1  0
 27 28  1  0
  6  1  1  0
 12 13  2  0
  1  2  2  0
 11 14  2  0
 25 30  1  0
 26 29  1  0
 29 27  2  0
 28 30  2  0
  4  7  1  0
 26 31  1  0
 10 15  1  1
  9 32  1  6
 32 33  2  0
  3  4  2  0
 34 35  1  0
 15 16  2  0
  7  8  1  0
 15 17  1  0
 17 18  2  0
 32 37  1  0
 33 36  1  0
 36 34  2  0
 35 37  2  0
  8  9  1  0
 36 38  1  0
M  END

Associated Targets(non-human)

Genome polyprotein (78 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 506.56Molecular Weight (Monoisotopic): 506.1842AlogP: 4.83#Rotatable Bonds: 8
Polar Surface Area: 96.80Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.22CX Basic pKa: 5.02CX LogP: 5.20CX LogD: 5.19
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.21Np Likeness Score: -0.83

References

1. Podvinec M, Lim SP, Schmidt T, Scarsi M, Wen D, Sonntag LS, Sanschagrin P, Shenkin PS, Schwede T..  (2010)  Novel inhibitors of dengue virus methyltransferase: discovery by in vitro-driven virtual screening on a desktop computer grid.,  53  (4): [PMID:20108931] [10.1021/jm900776m]

Source